1-(4-fluorophenyl)-4-(4-(pyrimidin-2-yl)-1,4-diazepan-1-yl)butan-1-one oxime

ID: ALA4554850

PubChem CID: 155556295

Max Phase: Preclinical

Molecular Formula: C19H24FN5O

Molecular Weight: 357.43

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O/N=C(/CCCN1CCCN(c2ncccn2)CC1)c1ccc(F)cc1

Standard InChI:  InChI=1S/C19H24FN5O/c20-17-7-5-16(6-8-17)18(23-26)4-1-11-24-12-3-13-25(15-14-24)19-21-9-2-10-22-19/h2,5-10,26H,1,3-4,11-15H2/b23-18-

Standard InChI Key:  NBTOXXDFQOHTRO-NKFKGCMQSA-N

Molfile:  

 
     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
   24.0356   -2.8436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0344   -3.6632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7425   -4.0721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4521   -3.6627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4493   -2.8400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7407   -2.4348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3264   -4.0712    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   26.1555   -2.4288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8647   -2.8347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1524   -1.6116    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.4431   -1.2057    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.5709   -2.4234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2801   -2.8294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9863   -2.4181    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.9255   -1.6104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5226   -1.0497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6674   -2.8794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3305   -1.1635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4481   -2.6334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7403   -1.8692    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.5568   -1.8655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9664   -2.5731    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.7821   -2.5697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1880   -1.8602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7721   -1.1527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9578   -1.1595    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  5  8  1  0
  8  9  1  0
  8 10  2  0
 10 11  1  0
  9 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 14 17  1  0
 16 18  1  0
 17 19  1  0
 18 20  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4554850

    ---

Associated Targets(Human)

SIGMAR1 Tclin Sigma opioid receptor (6358 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TMEM97 Tchem Sigma intracellular receptor 2 (973 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 357.43Molecular Weight (Monoisotopic): 357.1965AlogP: 2.79#Rotatable Bonds: 6
Polar Surface Area: 64.85Molecular Species: BASEHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 7.15CX Basic pKa: 8.91CX LogP: 1.35CX LogD: 1.24
Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.49Np Likeness Score: -1.87

References

1. Al-Ghanim L, Zhu XY, Asong G, Ablordeppey SY..  (2019)  SYA 013 analogs as moderately selective sigma-2 (σ2) ligands: Structure-affinity relationship studies.,  27  (12): [PMID:30737135] [10.1016/j.bmc.2019.01.035]

Source