Schwarzinicine D

ID: ALA4554888

PubChem CID: 155556573

Max Phase: Preclinical

Molecular Formula: C30H37NO7

Molecular Weight: 523.63

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(CCC(Cc2ccc(OC)c(OC)c2)NCCc2cc(OC)c3c(c2)OCO3)cc1OC

Standard InChI:  InChI=1S/C30H37NO7/c1-32-24-10-7-20(15-26(24)34-3)6-9-23(14-21-8-11-25(33-2)27(16-21)35-4)31-13-12-22-17-28(36-5)30-29(18-22)37-19-38-30/h7-8,10-11,15-18,23,31H,6,9,12-14,19H2,1-5H3

Standard InChI Key:  LDVSZWBQDOPRJF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
   18.9282  -17.4842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6362  -17.0728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3404  -17.4836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3404  -18.3031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6388  -18.7096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9282  -18.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2160  -18.7160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.2160  -19.5313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0526  -18.7107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7607  -18.3031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4687  -18.7107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1768  -18.3031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8890  -18.7107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5973  -18.3033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3018  -18.7102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3018  -19.5300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5999  -19.9367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8890  -19.5311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0140  -19.9376    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.7221  -19.5300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0140  -18.3025    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.0140  -17.4830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7607  -17.4836    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.4687  -17.0718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4687  -16.2565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1768  -15.8447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1772  -15.0252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8868  -14.6202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5952  -15.0280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5974  -15.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8892  -16.2549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3055  -16.2535    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.0177  -15.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2051  -14.4801    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.8694  -13.7327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0560  -13.8178    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.2160  -17.0724    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.5080  -17.4842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  7  8  1  0
  4  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 14 13  2  0
 15 14  1  0
 16 15  2  0
 17 16  1  0
 18 17  2  0
 13 18  1  0
 16 19  1  0
 19 20  1  0
 15 21  1  0
 21 22  1  0
 10 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
 26 31  1  0
 30 32  1  0
 32 33  1  0
 29 34  1  0
 35 34  1  0
 36 35  1  0
 28 36  1  0
  1 37  1  0
 37 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4554888

    ---

Associated Targets(non-human)

Aorta (2975 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 523.63Molecular Weight (Monoisotopic): 523.2570AlogP: 4.83#Rotatable Bonds: 14
Polar Surface Area: 76.64Molecular Species: BASEHBA: 8HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 10.43CX LogP: 5.19CX LogD: 2.36
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.32Np Likeness Score: 0.37

References

1. Krishnan P, Lee FK, Yap VA, Low YY, Kam TS, Yong KT, Ting KN, Lim KH..  (2020)  Schwarzinicines A-G, 1,4-Diarylbutanoid-Phenethylamine Conjugates from the Leaves of Ficus schwarzii.,  83  (1): [PMID:31935094] [10.1021/acs.jnatprod.9b01160]

Source