5-((5-(2,4-dimethoxyphenyl)-4-(methylamino)pyrimidin-2-yl)amino)-3-(piperidin-3-yloxy)picolinonitrile

ID: ALA4554892

PubChem CID: 155556574

Max Phase: Preclinical

Molecular Formula: C24H27N7O3

Molecular Weight: 461.53

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CNc1nc(Nc2cnc(C#N)c(OC3CCCNC3)c2)ncc1-c1ccc(OC)cc1OC

Standard InChI:  InChI=1S/C24H27N7O3/c1-26-23-19(18-7-6-16(32-2)10-21(18)33-3)14-29-24(31-23)30-15-9-22(20(11-25)28-12-15)34-17-5-4-8-27-13-17/h6-7,9-10,12,14,17,27H,4-5,8,13H2,1-3H3,(H2,26,29,30,31)

Standard InChI Key:  UJLSQRXUIIUPTR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   33.3408   -4.5155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0559   -4.9275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0522   -5.7531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7668   -6.1646    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.4818   -5.7507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4778   -4.9212    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.7627   -4.5135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1977   -6.1613    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.9113   -5.7466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6231   -6.1608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3361   -5.7467    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.3342   -4.9205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6132   -4.5102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9031   -4.9266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0471   -4.5049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7601   -4.0892    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.6079   -3.6849    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.3199   -3.2677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0321   -3.6778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7421   -3.2641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7411   -2.4384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0238   -2.0282    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.3077   -2.4436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7580   -3.6882    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.4703   -3.2714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3426   -3.6905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6283   -3.2786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9130   -3.6919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9164   -4.5215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6312   -4.9297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1973   -3.2809    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.1954   -2.4556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6351   -5.7550    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.9223   -6.1710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  5  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 12 15  1  0
 15 16  3  0
 13 17  1  0
 17 18  1  0
 18 19  1  0
 18 23  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
  7 24  1  0
 24 25  1  0
  2  1  1  0
  1 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30  1  1  0
 28 31  1  0
 31 32  1  0
 30 33  1  0
 33 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4554892

    ---

Associated Targets(Human)

CHEK1 Tchem Serine/threonine-protein kinase Chk1 (6846 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 461.53Molecular Weight (Monoisotopic): 461.2175AlogP: 3.34#Rotatable Bonds: 8
Polar Surface Area: 126.24Molecular Species: BASEHBA: 10HBD: 3
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 9.79CX Basic pKa: 9.37CX LogP: 2.09CX LogD: 0.58
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.46Np Likeness Score: -0.77

References

1. Tong L, Song P, Jiang K, Xu L, Jin T, Wang P, Hu X, Fang S, Gao A, Zhou Y, Liu T, Li J, Hu Y..  (2019)  Discovery of (R)-5-((5-(1-methyl-1H-pyrazol-4-yl)-4-(methylamino)pyrimidin-2-yl)amino)-3-(piperidin-3-yloxy)picolinonitrile, a novel CHK1 inhibitor for hematologic malignancies.,  173  [PMID:30986571] [10.1016/j.ejmech.2019.03.062]

Source