The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-((5-(2,4-dimethoxyphenyl)-4-(methylamino)pyrimidin-2-yl)amino)-3-(piperidin-3-yloxy)picolinonitrile ID: ALA4554892
PubChem CID: 155556574
Max Phase: Preclinical
Molecular Formula: C24H27N7O3
Molecular Weight: 461.53
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CNc1nc(Nc2cnc(C#N)c(OC3CCCNC3)c2)ncc1-c1ccc(OC)cc1OC
Standard InChI: InChI=1S/C24H27N7O3/c1-26-23-19(18-7-6-16(32-2)10-21(18)33-3)14-29-24(31-23)30-15-9-22(20(11-25)28-12-15)34-17-5-4-8-27-13-17/h6-7,9-10,12,14,17,27H,4-5,8,13H2,1-3H3,(H2,26,29,30,31)
Standard InChI Key: UJLSQRXUIIUPTR-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
33.3408 -4.5155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0559 -4.9275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0522 -5.7531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7668 -6.1646 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.4818 -5.7507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4778 -4.9212 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.7627 -4.5135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1977 -6.1613 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.9113 -5.7466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6231 -6.1608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3361 -5.7467 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.3342 -4.9205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6132 -4.5102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9031 -4.9266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0471 -4.5049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7601 -4.0892 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.6079 -3.6849 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.3199 -3.2677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0321 -3.6778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7421 -3.2641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7411 -2.4384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0238 -2.0282 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.3077 -2.4436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7580 -3.6882 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.4703 -3.2714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3426 -3.6905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6283 -3.2786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9130 -3.6919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9164 -4.5215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6312 -4.9297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1973 -3.2809 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.1954 -2.4556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6351 -5.7550 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.9223 -6.1710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
5 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
12 15 1 0
15 16 3 0
13 17 1 0
17 18 1 0
18 19 1 0
18 23 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
7 24 1 0
24 25 1 0
2 1 1 0
1 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 1 1 0
28 31 1 0
31 32 1 0
30 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 461.53Molecular Weight (Monoisotopic): 461.2175AlogP: 3.34#Rotatable Bonds: 8Polar Surface Area: 126.24Molecular Species: BASEHBA: 10HBD: 3#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.79CX Basic pKa: 9.37CX LogP: 2.09CX LogD: 0.58Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.46Np Likeness Score: -0.77
References 1. Tong L, Song P, Jiang K, Xu L, Jin T, Wang P, Hu X, Fang S, Gao A, Zhou Y, Liu T, Li J, Hu Y.. (2019) Discovery of (R)-5-((5-(1-methyl-1H-pyrazol-4-yl)-4-(methylamino)pyrimidin-2-yl)amino)-3-(piperidin-3-yloxy)picolinonitrile, a novel CHK1 inhibitor for hematologic malignancies., 173 [PMID:30986571 ] [10.1016/j.ejmech.2019.03.062 ]