7-(3-aminoprop-1-ynyl)-2-cyclohexyl-6-fluoro-N-(1-isopropylpiperidin-4-yl)quinazolin-4-amine

ID: ALA4554966

PubChem CID: 155556376

Max Phase: Preclinical

Molecular Formula: C25H34FN5

Molecular Weight: 423.58

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)N1CCC(Nc2nc(C3CCCCC3)nc3cc(C#CCN)c(F)cc23)CC1

Standard InChI:  InChI=1S/C25H34FN5/c1-17(2)31-13-10-20(11-14-31)28-25-21-16-22(26)19(9-6-12-27)15-23(21)29-24(30-25)18-7-4-3-5-8-18/h15-18,20H,3-5,7-8,10-14,27H2,1-2H3,(H,28,29,30)

Standard InChI Key:  BZHUDBDRJPBMIQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   29.0089   -4.6225    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.0077   -5.4420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7158   -5.8510    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.7140   -4.2136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4226   -4.6189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4234   -5.4379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1319   -5.8449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8402   -5.4341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8354   -4.6120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1263   -4.2086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7115   -3.3964    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.0026   -2.9899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0028   -2.1693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2979   -1.7629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5890   -2.1701    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.5895   -2.9882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2989   -3.3991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8816   -1.7609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3032   -5.8478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5960   -5.4364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8901   -5.8410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8852   -6.6585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5924   -7.0698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3045   -6.6637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8823   -0.9437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1736   -2.1690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5494   -5.8400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2589   -6.2408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9704   -6.6427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9781   -7.4599    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.5406   -4.1991    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  4 11  1  0
 11 12  1  0
 12 13  1  0
 12 17  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 15 18  1  0
 19 20  1  0
 19 24  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
  2 19  1  0
 18 25  1  0
 18 26  1  0
  8 27  1  0
 27 28  3  0
 28 29  1  0
 29 30  1  0
  9 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4554966

    ---

Associated Targets(Human)

EHMT2 Tchem Histone-lysine N-methyltransferase, H3 lysine-9 specific 3 (93046 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
EHMT1 Tchem Histone-lysine N-methyltransferase, H3 lysine-9 specific 5 (407 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 423.58Molecular Weight (Monoisotopic): 423.2798AlogP: 4.41#Rotatable Bonds: 4
Polar Surface Area: 67.07Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.36CX LogP: 4.57CX LogD: 1.55
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.71Np Likeness Score: -1.16

References

1. Leenders R, Zijlmans R, van Bree B, van de Sande M, Trivarelli F, Damen E, Wegert A, Müller D, Ehlert JE, Feger D, Heidemann-Dinger C, Kubbutat M, Schächtele C, Lenstra DC, Mecinović J, Müller G..  (2019)  Novel SAR for quinazoline inhibitors of EHMT1 and EHMT2.,  29  (17): [PMID:31350126] [10.1016/j.bmcl.2019.06.012]

Source