The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3E,5E)-3-(3-pyridylmethylene)-5-(2-trifluoromethylbenzylidene)-1-((4-trifluoromethylphenyl)sulfonyl)piperidin-4-one ID: ALA4555038
PubChem CID: 155556055
Max Phase: Preclinical
Molecular Formula: C26H18F6N2O3S
Molecular Weight: 552.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C1/C(=C/c2cccnc2)CN(S(=O)(=O)c2ccc(C(F)(F)F)cc2)C/C1=C\c1ccccc1C(F)(F)F
Standard InChI: InChI=1S/C26H18F6N2O3S/c27-25(28,29)21-7-9-22(10-8-21)38(36,37)34-15-19(12-17-4-3-11-33-14-17)24(35)20(16-34)13-18-5-1-2-6-23(18)26(30,31)32/h1-14H,15-16H2/b19-12+,20-13+
Standard InChI Key: WYKUYRINMBDPKK-KVOOEGMKSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
38.9569 -4.4780 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.1397 -4.4780 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
38.5483 -5.1858 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.6054 -2.4515 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.6042 -3.2711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3123 -3.6800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0220 -3.2706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0191 -2.4479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3105 -2.0427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7253 -2.0367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4345 -2.4426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4350 -3.2570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1402 -3.6629 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.8488 -3.2551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8477 -2.4369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1380 -2.0266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1339 -1.2094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.5552 -2.0281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2631 -2.4364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2587 -3.2533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9657 -3.6616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6742 -3.2527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6713 -2.4313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9637 -2.0267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9597 -1.2095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4325 -4.8886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7283 -4.4758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0210 -4.8837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0206 -5.7018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7333 -6.1102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4376 -5.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3134 -6.1113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6052 -5.7037 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
35.3145 -6.9285 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
34.6027 -6.5128 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
41.6654 -0.7975 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
40.2500 -0.8044 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
40.9545 -0.3921 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
8 10 1 0
10 11 2 0
11 12 1 0
11 16 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
15 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
24 25 1 0
13 2 1 0
2 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
29 32 1 0
32 33 1 0
32 34 1 0
32 35 1 0
25 36 1 0
25 37 1 0
25 38 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 552.50Molecular Weight (Monoisotopic): 552.0942AlogP: 5.86#Rotatable Bonds: 4Polar Surface Area: 67.34Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 4.82CX LogP: 5.66CX LogD: 5.66Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.30Np Likeness Score: -1.21
References 1. Yao BR, Sun Y, Chen SL, Suo HD, Zhang YL, Wei H, Wang CH, Zhao F, Cong W, Xin WY, Hou GG.. (2019) Dissymmetric pyridyl-substituted 3,5-bis(arylidene)-4-piperidones as anti-hepatoma agents by inhibiting NF-κB pathway activation., 167 [PMID:30771605 ] [10.1016/j.ejmech.2019.02.020 ]