Ethyl 2-(4-methoxyphenyl)-4-oxo-1,4-dihydroquinoline-6-carboxylate

ID: ALA4555042

PubChem CID: 155209376

Max Phase: Preclinical

Molecular Formula: C19H17NO4

Molecular Weight: 323.35

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)c1ccc2[nH]c(-c3ccc(OC)cc3)cc(=O)c2c1

Standard InChI:  InChI=1S/C19H17NO4/c1-3-24-19(22)13-6-9-16-15(10-13)18(21)11-17(20-16)12-4-7-14(23-2)8-5-12/h4-11H,3H2,1-2H3,(H,20,21)

Standard InChI Key:  JASKCGMRIQRIRU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
   31.0931   -3.4421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0920   -4.2616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8000   -4.6706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7982   -3.0332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5069   -3.4385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5057   -4.2637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2158   -4.6750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.9316   -4.2657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9328   -3.4405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2181   -3.0246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6343   -4.6761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6306   -5.4944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3364   -5.9049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0462   -5.4982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0459   -4.6768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3396   -4.2700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2182   -2.2074    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.3853   -3.0336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3851   -2.2165    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.6777   -3.4424    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.9699   -3.0340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2623   -3.4427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7533   -5.9079    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.7521   -6.7251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  8 11  1  0
 10 17  2  0
  1 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 14 23  1  0
 23 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4555042

    ---

Associated Targets(Human)

NCI-H1975 (4994 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 323.35Molecular Weight (Monoisotopic): 323.1158AlogP: 3.38#Rotatable Bonds: 4
Polar Surface Area: 68.39Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.45CX LogD: 3.45
Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.75Np Likeness Score: -0.37

References

1. Lin MS, Hong TM, Chou TH, Yang SC, Chung WC, Weng CW, Tsai ML, Cheng TR, Chen JJW, Lee TC, Wong CH, Chein RJ, Yang PC..  (2019)  4(1H)-quinolone derivatives overcome acquired resistance to anti-microtubule agents by targeting the colchicine site of β-tubulin.,  181  [PMID:31419740] [10.1016/j.ejmech.2019.111584]

Source