1-(4-chlorophenyl)-4-(2-fluorophenyl)-5-methylene-1H-pyrrol-2(5H)-one

ID: ALA4555225

PubChem CID: 155556464

Max Phase: Preclinical

Molecular Formula: C17H11ClFNO

Molecular Weight: 299.73

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=C1C(c2ccccc2F)=CC(=O)N1c1ccc(Cl)cc1

Standard InChI:  InChI=1S/C17H11ClFNO/c1-11-15(14-4-2-3-5-16(14)19)10-17(21)20(11)13-8-6-12(18)7-9-13/h2-10H,1H2

Standard InChI Key:  HQOVJYCPOAHICZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 21 23  0  0  0  0  0  0  0  0999 V2000
   18.2203  -25.7374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2192  -26.5569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9272  -26.9659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6369  -26.5564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6340  -25.7338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9254  -25.3285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5111  -26.9649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7694  -26.6311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2221  -27.2380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6302  -27.9461    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.4296  -27.7767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4094  -27.1519    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.0379  -28.3223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3012  -28.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4872  -28.7753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1543  -29.5208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6343  -30.1832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4510  -30.0953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7802  -29.3497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5125  -25.3289    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   15.3024  -30.9300    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11  7  1  0
  9 12  2  0
 11 13  2  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 10 14  1  0
  1 20  1  0
 17 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4555225

    ---

Associated Targets(non-human)

Pseudomonas aeruginosa (123386 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 299.73Molecular Weight (Monoisotopic): 299.0513AlogP: 4.42#Rotatable Bonds: 2
Polar Surface Area: 20.31Molecular Species: NEUTRALHBA: 1HBD:
#RO5 Violations: HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.94CX LogD: 3.94
Aromatic Rings: 2Heavy Atoms: 21QED Weighted: 0.80Np Likeness Score: -0.86

References

1. Almohaywi B, Yu TT, Iskander G, Chan DSH, Ho KKK, Rice S, Black DS, Griffith R, Kumar N..  (2019)  Dihydropyrrolones as bacterial quorum sensing inhibitors.,  29  (9): [PMID:30857746] [10.1016/j.bmcl.2019.03.004]

Source