(2S,4R)-4-[((S)-1-Carboxymethyl-2-p-tolyl-ethylcarbamoyl)-methoxy]-2-(pyridin-2-ylaminomethyl)-pyrrolidine-1-carboxylic acid benzyl ester

ID: ALA4555363

PubChem CID: 58916186

Max Phase: Preclinical

Molecular Formula: C31H36N4O6

Molecular Weight: 560.65

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(C[C@@H](CC(=O)O)NC(=O)CO[C@@H]2C[C@@H](CNc3ccccn3)N(C(=O)OCc3ccccc3)C2)cc1

Standard InChI:  InChI=1S/C31H36N4O6/c1-22-10-12-23(13-11-22)15-25(16-30(37)38)34-29(36)21-40-27-17-26(18-33-28-9-5-6-14-32-28)35(19-27)31(39)41-20-24-7-3-2-4-8-24/h2-14,25-27H,15-21H2,1H3,(H,32,33)(H,34,36)(H,37,38)/t25-,26-,27+/m0/s1

Standard InChI Key:  YPXUVYRKQVFCJD-GMQQYTKMSA-N

Molfile:  

 
     RDKit          2D

 41 44  0  0  0  0  0  0  0  0999 V2000
   10.0565   -9.2370    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5299   -8.5934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7072   -8.7318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1767   -8.0866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3796   -8.3448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1095   -9.1287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2842   -9.1122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0493   -8.3273    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2567   -8.0576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0921   -7.2450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3075   -6.9733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6329   -8.6023    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7349   -7.8551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7165   -9.7146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9202   -9.5247    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3565  -10.1228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8220   -7.8139    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5589   -9.9290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9956  -10.5264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2316  -11.3146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0362  -11.5020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5961  -10.9033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1515   -6.1631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7781   -5.6260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6228   -4.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8425   -4.5459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2174   -5.0909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3761   -5.8983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8707   -9.1039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3930   -9.7423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1624   -8.3322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9766   -8.1990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2684   -7.4274    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4990   -8.8376    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.1013  -10.5140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2871  -10.6428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9952  -11.4137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5178  -12.0531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3358  -11.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6239  -11.1459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2271  -12.8252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  6
  6  5  1  0
  7  6  1  0
  8  7  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
  9 12  2  0
  8 13  1  0
  5 13  1  0
  7 14  1  1
 14 15  1  0
 15 16  1  0
  2 17  2  0
 16 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 16  1  0
 11 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 29  1  1  6
 29 30  1  0
 29 31  1  0
 31 32  1  0
 32 33  2  0
 32 34  1  0
 30 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 39  1  0
 39 40  2  0
 40 35  1  0
 38 41  1  0
M  END

Associated Targets(Human)

ITGB1 Tclin Integrin alpha-5/beta-1 (686 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 560.65Molecular Weight (Monoisotopic): 560.2635AlogP: 3.80#Rotatable Bonds: 13
Polar Surface Area: 130.09Molecular Species: ACIDHBA: 7HBD: 3
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.42CX Basic pKa: 6.63CX LogP: 1.89CX LogD: 1.16
Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.29Np Likeness Score: -0.64

References

1.  (2013)  Compounds for the inhibition of angiogenesis and use thereof, 

Source