The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,4R)-4-[((S)-1-Carboxymethyl-2-p-tolyl-ethylcarbamoyl)-methoxy]-2-(pyridin-2-ylaminomethyl)-pyrrolidine-1-carboxylic acid benzyl ester ID: ALA4555363
PubChem CID: 58916186
Max Phase: Preclinical
Molecular Formula: C31H36N4O6
Molecular Weight: 560.65
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(C[C@@H](CC(=O)O)NC(=O)CO[C@@H]2C[C@@H](CNc3ccccn3)N(C(=O)OCc3ccccc3)C2)cc1
Standard InChI: InChI=1S/C31H36N4O6/c1-22-10-12-23(13-11-22)15-25(16-30(37)38)34-29(36)21-40-27-17-26(18-33-28-9-5-6-14-32-28)35(19-27)31(39)41-20-24-7-3-2-4-8-24/h2-14,25-27H,15-21H2,1H3,(H,32,33)(H,34,36)(H,37,38)/t25-,26-,27+/m0/s1
Standard InChI Key: YPXUVYRKQVFCJD-GMQQYTKMSA-N
Molfile:
RDKit 2D
41 44 0 0 0 0 0 0 0 0999 V2000
10.0565 -9.2370 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5299 -8.5934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7072 -8.7318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1767 -8.0866 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3796 -8.3448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1095 -9.1287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2842 -9.1122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0493 -8.3273 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2567 -8.0576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0921 -7.2450 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3075 -6.9733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6329 -8.6023 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7349 -7.8551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7165 -9.7146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9202 -9.5247 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3565 -10.1228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8220 -7.8139 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5589 -9.9290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9956 -10.5264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2316 -11.3146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0362 -11.5020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5961 -10.9033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1515 -6.1631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7781 -5.6260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6228 -4.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8425 -4.5459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2174 -5.0909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3761 -5.8983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8707 -9.1039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3930 -9.7423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1624 -8.3322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9766 -8.1990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2684 -7.4274 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4990 -8.8376 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1013 -10.5140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2871 -10.6428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9952 -11.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5178 -12.0531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3358 -11.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6239 -11.1459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2271 -12.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 1 0
5 4 1 6
6 5 1 0
7 6 1 0
8 7 1 0
8 9 1 0
9 10 1 0
10 11 1 0
9 12 2 0
8 13 1 0
5 13 1 0
7 14 1 1
14 15 1 0
15 16 1 0
2 17 2 0
16 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 16 1 0
11 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
29 1 1 6
29 30 1 0
29 31 1 0
31 32 1 0
32 33 2 0
32 34 1 0
30 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
38 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 560.65Molecular Weight (Monoisotopic): 560.2635AlogP: 3.80#Rotatable Bonds: 13Polar Surface Area: 130.09Molecular Species: ACIDHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.42CX Basic pKa: 6.63CX LogP: 1.89CX LogD: 1.16Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.29Np Likeness Score: -0.64
References 1. (2013) Compounds for the inhibition of angiogenesis and use thereof,