5-(4-(3-Carboxyphenyl)-1H-1,2,3-triazol-1-yl)-4'-(piperidin-4-yl)-[1,1'-biphenyl]-3-carboxylic Acid

ID: ALA4555395

PubChem CID: 135356800

Max Phase: Preclinical

Molecular Formula: C27H24N4O4

Molecular Weight: 468.51

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)c1cccc(-c2cn(-c3cc(C(=O)O)cc(-c4ccc(C5CCNCC5)cc4)c3)nn2)c1

Standard InChI:  InChI=1S/C27H24N4O4/c32-26(33)21-3-1-2-20(12-21)25-16-31(30-29-25)24-14-22(13-23(15-24)27(34)35)18-6-4-17(5-7-18)19-8-10-28-11-9-19/h1-7,12-16,19,28H,8-11H2,(H,32,33)(H,34,35)

Standard InChI Key:  XCKCLKZNBZBHAL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   26.3605  -12.3831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1760  -12.3843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5829  -11.6798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1755  -10.9737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3570  -10.9765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9537  -11.6815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3963  -11.6775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8041  -12.3869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6205  -12.3874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0301  -11.6793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6173  -10.9691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8022  -10.9721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8456  -11.6763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2537  -12.3853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0673  -12.3864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4790  -11.6801    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.0709  -10.9710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2511  -10.9683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9457  -10.2703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3516   -9.5611    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.1285  -10.2734    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.9527  -13.0947    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.1400  -13.1803    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.9703  -13.9797    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.6781  -14.3882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2852  -13.8411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7623  -15.1982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0996  -15.6783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1849  -16.4903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9321  -16.8232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5950  -16.3380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5064  -15.5277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5237  -16.9705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7772  -16.6380    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.6090  -17.7832    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  3  7  1  0
 13 14  1  0
 13 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 10 13  1  0
  5 19  1  0
 19 20  1  0
 19 21  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 22  1  0
  1 22  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 25 27  1  0
 29 33  1  0
 33 34  2  0
 33 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4555395

    ---

Associated Targets(Human)

P2RY14 Tchem Purinergic receptor P2Y14 (692 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 468.51Molecular Weight (Monoisotopic): 468.1798AlogP: 4.46#Rotatable Bonds: 6
Polar Surface Area: 117.34Molecular Species: ZWITTERIONHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 3.59CX Basic pKa: 10.07CX LogP: 2.03CX LogD: -0.73
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.38Np Likeness Score: -0.83

References

1. Junker A, Balasubramanian R, Ciancetta A, Uliassi E, Kiselev E, Martiriggiano C, Trujillo K, Mtchedlidze G, Birdwell L, Brown KA, Harden TK, Jacobson KA..  (2016)  Structure-Based Design of 3-(4-Aryl-1H-1,2,3-triazol-1-yl)-Biphenyl Derivatives as P2Y14 Receptor Antagonists.,  59  (13): [PMID:27331270] [10.1021/acs.jmedchem.6b00044]

Source