(2S,4R)-4-[((S)-2-Carboxy-2-methanesulfonylamino-ethylcarbamoyl)-methoxy]-2-(pyridin-2-ylaminomethyl)-pyrrolidine-1-carboxylic acid benzyl ester

ID: ALA4555420

PubChem CID: 155557190

Max Phase: Preclinical

Molecular Formula: C24H31N5O8S

Molecular Weight: 549.61

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CS(=O)(=O)N[C@@H](CNC(=O)CO[C@@H]1C[C@@H](CNc2ccccn2)N(C(=O)OCc2ccccc2)C1)C(=O)O

Standard InChI:  InChI=1S/C24H31N5O8S/c1-38(34,35)28-20(23(31)32)13-27-22(30)16-36-19-11-18(12-26-21-9-5-6-10-25-21)29(14-19)24(33)37-15-17-7-3-2-4-8-17/h2-10,18-20,28H,11-16H2,1H3,(H,25,26)(H,27,30)(H,31,32)/t18-,19+,20-/m0/s1

Standard InChI Key:  JKBYXAXOFKHPTA-ZCNNSNEGSA-N

Molfile:  

 
     RDKit          2D

 38 40  0  0  0  0  0  0  0  0999 V2000
   13.1411   -5.2498    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8510   -5.6584    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   13.8499   -4.8394    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7596   -6.5587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5657   -6.4248    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.4724   -7.3237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6662   -7.4576    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9914   -7.9550    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6590   -5.5259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7327   -3.8301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5086   -4.0901    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6720   -4.8929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0586   -5.4330    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5702   -3.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1838   -2.4939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0217   -1.6937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2462   -1.4333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6325   -1.9793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7977   -2.7775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4466   -5.1531    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0135   -7.7191    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3331   -6.3439    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.1907   -4.6481    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9726   -6.7476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7705   -5.1727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4482   -8.3192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6619   -8.1391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5013   -5.9495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0846   -5.5540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4201   -6.0573    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.7716   -6.9355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1282   -4.6891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4112   -7.3434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5602   -4.9156    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.2354   -5.9235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1221   -6.5288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8998   -5.4203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6834   -5.9330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  6
  4  6  1  0
  6  7  1  0
  6  8  2  0
  5  2  1  0
  2  9  1  0
 12 11  1  0
 12 13  2  0
 11 10  1  0
 10 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 12 20  1  0
 35  4  1  0
 27 26  2  0
 37 23  2  0
 34 29  1  0
 25 32  1  0
 20 32  1  0
 25 34  1  6
 29 37  1  0
 38 36  1  1
 30 35  1  0
 31 21  2  0
 20 38  1  0
 22 31  1  0
 24 33  2  0
 37 30  1  0
 36 22  1  0
 38 28  1  0
 31 24  1  0
 28 25  1  0
 26 21  1  0
 33 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4555420

    ---

Associated Targets(Human)

ITGB1 Tclin Integrin alpha-5/beta-1 (686 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 549.61Molecular Weight (Monoisotopic): 549.1893AlogP: 0.41#Rotatable Bonds: 13
Polar Surface Area: 176.26Molecular Species: ACIDHBA: 9HBD: 4
#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.25CX Basic pKa: 6.63CX LogP: -2.24CX LogD: -3.04
Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.27Np Likeness Score: -0.84

References

1.  (2013)  Compounds for the inhibition of angiogenesis and use thereof, 

Source