The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,4R)-4-[((S)-2-Carboxy-2-methanesulfonylamino-ethylcarbamoyl)-methoxy]-2-(pyridin-2-ylaminomethyl)-pyrrolidine-1-carboxylic acid benzyl ester ID: ALA4555420
PubChem CID: 155557190
Max Phase: Preclinical
Molecular Formula: C24H31N5O8S
Molecular Weight: 549.61
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CS(=O)(=O)N[C@@H](CNC(=O)CO[C@@H]1C[C@@H](CNc2ccccn2)N(C(=O)OCc2ccccc2)C1)C(=O)O
Standard InChI: InChI=1S/C24H31N5O8S/c1-38(34,35)28-20(23(31)32)13-27-22(30)16-36-19-11-18(12-26-21-9-5-6-10-25-21)29(14-19)24(33)37-15-17-7-3-2-4-8-17/h2-10,18-20,28H,11-16H2,1H3,(H,25,26)(H,27,30)(H,31,32)/t18-,19+,20-/m0/s1
Standard InChI Key: JKBYXAXOFKHPTA-ZCNNSNEGSA-N
Molfile:
RDKit 2D
38 40 0 0 0 0 0 0 0 0999 V2000
13.1411 -5.2498 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8510 -5.6584 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.8499 -4.8394 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7596 -6.5587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5657 -6.4248 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.4724 -7.3237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6662 -7.4576 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9914 -7.9550 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6590 -5.5259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7327 -3.8301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5086 -4.0901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6720 -4.8929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0586 -5.4330 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5702 -3.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1838 -2.4939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0217 -1.6937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2462 -1.4333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6325 -1.9793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7977 -2.7775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4466 -5.1531 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0135 -7.7191 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3331 -6.3439 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1907 -4.6481 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9726 -6.7476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7705 -5.1727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4482 -8.3192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6619 -8.1391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5013 -5.9495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0846 -5.5540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4201 -6.0573 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7716 -6.9355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1282 -4.6891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4112 -7.3434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5602 -4.9156 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2354 -5.9235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1221 -6.5288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8998 -5.4203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6834 -5.9330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 6
4 6 1 0
6 7 1 0
6 8 2 0
5 2 1 0
2 9 1 0
12 11 1 0
12 13 2 0
11 10 1 0
10 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
12 20 1 0
35 4 1 0
27 26 2 0
37 23 2 0
34 29 1 0
25 32 1 0
20 32 1 0
25 34 1 6
29 37 1 0
38 36 1 1
30 35 1 0
31 21 2 0
20 38 1 0
22 31 1 0
24 33 2 0
37 30 1 0
36 22 1 0
38 28 1 0
31 24 1 0
28 25 1 0
26 21 1 0
33 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 549.61Molecular Weight (Monoisotopic): 549.1893AlogP: 0.41#Rotatable Bonds: 13Polar Surface Area: 176.26Molecular Species: ACIDHBA: 9HBD: 4#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.25CX Basic pKa: 6.63CX LogP: -2.24CX LogD: -3.04Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.27Np Likeness Score: -0.84
References 1. (2013) Compounds for the inhibition of angiogenesis and use thereof,