rac-trans-N,N'-(5,5'-cyclopropane-1,2-diylbis(methylene)bis(1,3,4-thiadiazole-5,2-diyl))bis(2-phenylacetamide)

ID: ALA4555453

PubChem CID: 89596774

Max Phase: Preclinical

Molecular Formula: C25H24N6O2S2

Molecular Weight: 504.64

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Cc1ccccc1)Nc1nnc(C[C@H]2C[C@@H]2Cc2nnc(NC(=O)Cc3ccccc3)s2)s1

Standard InChI:  InChI=1S/C25H24N6O2S2/c32-20(11-16-7-3-1-4-8-16)26-24-30-28-22(34-24)14-18-13-19(18)15-23-29-31-25(35-23)27-21(33)12-17-9-5-2-6-10-17/h1-10,18-19H,11-15H2,(H,26,30,32)(H,27,31,33)/t18-,19-/m1/s1

Standard InChI Key:  HROAFZLZQSBWII-RTBURBONSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
    7.3742  -12.9175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2864  -12.1051    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4866  -11.9375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0800  -12.6465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6287  -13.2521    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.2676  -12.7343    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7852  -12.0747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9728  -12.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1154  -11.3271    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4905  -11.5029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8224  -10.7552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3408  -10.0960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5274  -10.1835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1980  -10.9360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6816  -11.5921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0831  -13.3240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7896  -12.9134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6038  -12.9072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1931  -12.2007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3136  -13.3121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0192  -12.8998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7648  -13.2244    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   12.3084  -12.6143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8961  -11.9087    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0977  -12.0829    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.1215  -12.6955    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.5984  -12.0318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4116  -12.1130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2621  -11.2870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8884  -11.4494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7018  -11.5349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1785  -10.8720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8422  -10.1263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0246  -10.0473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5515  -10.7111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  1  1  0
  4  6  1  0
  6  7  1  0
  7  8  1  0
  7  9  2  0
  8 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  1 16  1  0
 17 16  1  1
 18 17  1  0
 19 18  1  0
 17 19  1  0
 18 20  1  6
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 21  2  0
 23 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  2  0
 28 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
M  END

Associated Targets(Human)

GLS Tchem Glutaminase kidney isoform, mitochondrial (16997 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 504.64Molecular Weight (Monoisotopic): 504.1402AlogP: 4.17#Rotatable Bonds: 10
Polar Surface Area: 109.76Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 6.65CX Basic pKa: 0.22CX LogP: 3.86CX LogD: 2.81
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.34Np Likeness Score: -0.82

References

1. Li L, Meng Y, Li Z, Dai W, Xu X, Bi X, Bian J..  (2019)  Discovery and development of small molecule modulators targeting glutamine metabolism.,  163  [PMID:30522056] [10.1016/j.ejmech.2018.11.066]

Source