The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
rac-trans-N,N'-(5,5'-cyclopropane-1,2-diylbis(methylene)bis(1,3,4-thiadiazole-5,2-diyl))bis(2-phenylacetamide) ID: ALA4555453
PubChem CID: 89596774
Max Phase: Preclinical
Molecular Formula: C25H24N6O2S2
Molecular Weight: 504.64
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Cc1ccccc1)Nc1nnc(C[C@H]2C[C@@H]2Cc2nnc(NC(=O)Cc3ccccc3)s2)s1
Standard InChI: InChI=1S/C25H24N6O2S2/c32-20(11-16-7-3-1-4-8-16)26-24-30-28-22(34-24)14-18-13-19(18)15-23-29-31-25(35-23)27-21(33)12-17-9-5-2-6-10-17/h1-10,18-19H,11-15H2,(H,26,30,32)(H,27,31,33)/t18-,19-/m1/s1
Standard InChI Key: HROAFZLZQSBWII-RTBURBONSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
7.3742 -12.9175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2864 -12.1051 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4866 -11.9375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0800 -12.6465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6287 -13.2521 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.2676 -12.7343 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7852 -12.0747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9728 -12.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1154 -11.3271 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4905 -11.5029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8224 -10.7552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3408 -10.0960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5274 -10.1835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1980 -10.9360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6816 -11.5921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0831 -13.3240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7896 -12.9134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6038 -12.9072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1931 -12.2007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3136 -13.3121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0192 -12.8998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7648 -13.2244 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.3084 -12.6143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8961 -11.9087 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0977 -12.0829 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.1215 -12.6955 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.5984 -12.0318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4116 -12.1130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2621 -11.2870 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8884 -11.4494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7018 -11.5349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1785 -10.8720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8422 -10.1263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0246 -10.0473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5515 -10.7111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 1 0
4 6 1 0
6 7 1 0
7 8 1 0
7 9 2 0
8 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
1 16 1 0
17 16 1 1
18 17 1 0
19 18 1 0
17 19 1 0
18 20 1 6
20 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 21 2 0
23 26 1 0
26 27 1 0
27 28 1 0
27 29 2 0
28 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 504.64Molecular Weight (Monoisotopic): 504.1402AlogP: 4.17#Rotatable Bonds: 10Polar Surface Area: 109.76Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 6.65CX Basic pKa: 0.22CX LogP: 3.86CX LogD: 2.81Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.34Np Likeness Score: -0.82
References 1. Li L, Meng Y, Li Z, Dai W, Xu X, Bi X, Bian J.. (2019) Discovery and development of small molecule modulators targeting glutamine metabolism., 163 [PMID:30522056 ] [10.1016/j.ejmech.2018.11.066 ]