The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Acetic acid 2-(2-{[2-(4-chlorophenyl)-1H-indol-3-ylmethylene]hydrazono}-4-oxo-thiazolidin-5-yl)ethyl ester ID: ALA4555640
PubChem CID: 155557076
Max Phase: Preclinical
Molecular Formula: C22H19ClN4O3S
Molecular Weight: 454.94
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)OCCC1S/C(=N\N=C\c2c(-c3ccc(Cl)cc3)[nH]c3ccccc23)NC1=O
Standard InChI: InChI=1S/C22H19ClN4O3S/c1-13(28)30-11-10-19-21(29)26-22(31-19)27-24-12-17-16-4-2-3-5-18(16)25-20(17)14-6-8-15(23)9-7-14/h2-9,12,19,25H,10-11H2,1H3,(H,26,27,29)/b24-12+
Standard InChI Key: WNGSIVFOYNKSSO-WYMPLXKRSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
14.7294 -23.0576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5551 -23.0576 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
15.8122 -22.2728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1423 -21.7856 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4767 -22.2728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5978 -22.0187 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2107 -22.5721 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.9963 -22.3180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6093 -22.8714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8262 -23.4146 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.4143 -22.6990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2728 -24.0274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5203 -23.6897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8539 -24.1723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9384 -24.9925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6955 -25.3277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3588 -24.8432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7495 -21.9456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5720 -21.8604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9078 -21.1069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4222 -20.4379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5971 -20.5275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2650 -21.2812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6913 -22.0180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2433 -23.7250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4221 -23.6376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7569 -19.6832 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
12.9360 -24.3050 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1149 -24.2176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6287 -24.8850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7799 -23.4629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
3 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 13 1 0
12 10 1 0
10 11 1 0
11 9 2 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
11 18 1 0
5 24 2 0
1 25 1 0
25 26 1 0
21 27 1 0
26 28 1 0
28 29 1 0
29 30 1 0
29 31 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 454.94Molecular Weight (Monoisotopic): 454.0866AlogP: 4.36#Rotatable Bonds: 6Polar Surface Area: 95.91Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.34CX Basic pKa: ┄CX LogP: 3.77CX LogD: 3.44Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.33Np Likeness Score: -0.62
References 1. Kryshchyshyn A, Kaminskyy D, Karpenko O, Gzella A, Grellier P, Lesyk R.. (2019) Thiazolidinone/thiazole based hybrids - New class of antitrypanosomal agents., 174 [PMID:31051403 ] [10.1016/j.ejmech.2019.04.052 ]