6-Bromo-N-(1H-indol-4-yl)-1-benzothiophene-2-carboxamide

ID: ALA4555677

PubChem CID: 146014943

Max Phase: Preclinical

Molecular Formula: C17H11BrN2OS

Molecular Weight: 371.26

Molecule Type: Unknown

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Nc1cccc2[nH]ccc12)c1cc2ccc(Br)cc2s1

Standard InChI:  InChI=1S/C17H11BrN2OS/c18-11-5-4-10-8-16(22-15(10)9-11)17(21)20-14-3-1-2-13-12(14)6-7-19-13/h1-9,19H,(H,20,21)

Standard InChI Key:  REBSMDZUSJUELV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 22 25  0  0  0  0  0  0  0  0999 V2000
   10.0394  -10.1960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4670   -9.3628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7559   -8.9504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0406   -9.3646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4708  -10.1928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7550  -10.6077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9299  -11.4155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7512  -11.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0854  -10.7510    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.3249  -10.6085    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6104  -10.1961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8960  -10.6086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6104   -9.3710    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1381  -10.2713    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.8056  -11.4272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9987  -11.5989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5884  -10.8861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7678  -10.8861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3566  -11.5981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7719  -12.3115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5911  -12.3081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5317  -11.5995    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  6  2  0
  5  2  2  0
  2  3  1  0
  3  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  1 10  1  0
 10 11  1  0
 11 12  1  0
 11 13  2  0
 12 14  1  0
 14 17  1  0
 16 15  1  0
 15 12  2  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 19 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4555677

    ---

Associated Targets(Human)

DHPS Tchem Deoxyhypusine synthase (182 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 371.26Molecular Weight (Monoisotopic): 369.9775AlogP: 5.40#Rotatable Bonds: 2
Polar Surface Area: 44.89Molecular Species: NEUTRALHBA: 2HBD: 2
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.94CX LogD: 4.94
Aromatic Rings: 4Heavy Atoms: 22QED Weighted: 0.49Np Likeness Score: -1.62

References

1. Tanaka Y, Kurasawa O, Yokota A, Klein MG, Ono K, Saito B, Matsumoto S, Okaniwa M, Ambrus-Aikelin G, Morishita D, Kitazawa S, Uchiyama N, Ogawa K, Kimura H, Imamura S..  (2020)  Discovery of Novel Allosteric Inhibitors of Deoxyhypusine Synthase.,  63  (6): [PMID:32142284] [10.1021/acs.jmedchem.9b01979]
2. Tanaka Y, Kurasawa O, Yokota A, Klein MG, Saito B, Matsumoto S, Okaniwa M, Ambrus-Aikelin G, Uchiyama N, Morishita D, Kimura H, Imamura S..  (2020)  New Series of Potent Allosteric Inhibitors of Deoxyhypusine Synthase.,  11  (8.0): [PMID:34345355] [10.1021/acsmedchemlett.0c00331]

Source