(R)-2-((5aR,6R,8R,9aR,10S)-6-acetoxy-10-hydroxy-5a-methyl-1-oxo-3-(pyridin-3-yl)-1,5a,6,7,8,9,9a,10-octahydropyrano[4,3-b]chromen-8-yl)propane-1,2-diyl diacetate

ID: ALA4555697

PubChem CID: 134188210

Max Phase: Preclinical

Molecular Formula: C27H31NO10

Molecular Weight: 529.54

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)OC[C@](C)(OC(C)=O)[C@@H]1C[C@@H]2[C@H](O)c3c(cc(-c4cccnc4)oc3=O)O[C@@]2(C)[C@H](OC(C)=O)C1

Standard InChI:  InChI=1S/C27H31NO10/c1-14(29)34-13-26(4,37-16(3)31)18-9-19-24(32)23-21(38-27(19,5)22(10-18)35-15(2)30)11-20(36-25(23)33)17-7-6-8-28-12-17/h6-8,11-12,18-19,22,24,32H,9-10,13H2,1-5H3/t18-,19-,22-,24+,26+,27-/m1/s1

Standard InChI Key:  NIGGKHQHUNJNPM-RQIUQXJASA-N

Molfile:  

 
     RDKit          2D

 40 43  0  0  0  0  0  0  0  0999 V2000
    7.7219  -24.1198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1460  -24.9449    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4339  -23.7031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1442  -24.1228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8590  -23.7198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8696  -22.8953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1593  -22.4756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4384  -22.8803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4339  -25.3533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7219  -24.9449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0160  -25.3551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0161  -26.1754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7282  -26.5838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4403  -26.1719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7273  -22.4615    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3022  -26.5891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1565  -26.5814    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5870  -26.1776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3035  -27.4142    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5858  -25.3525    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8705  -24.9411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8693  -24.1160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1567  -25.3546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4261  -24.5282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7176  -25.7700    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.5876  -22.4919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2976  -22.9143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0164  -22.5108    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.0263  -21.6848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3115  -21.2642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5957  -21.6702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1601  -27.4065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8765  -27.8160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4473  -27.8221    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2966  -25.7616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5895  -27.8279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5907  -28.6529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8744  -27.4163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0061  -23.7094    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0161  -27.0004    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1 10  1  0
  1  3  1  0
  9  2  1  0
  2  4  1  0
  3  4  2  0
  3  8  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  9 10  1  0
  9 14  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
  8 15  2  0
 12 16  1  0
 14 17  1  6
 16 18  1  1
 16 19  1  0
 18 20  1  0
 20 21  1  0
 21 22  2  0
 21 23  1  0
  9 24  1  6
 10 25  1  1
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
  6 26  1  0
 17 32  1  0
 32 33  1  0
 32 34  2  0
 16 35  1  0
 19 36  1  0
 36 37  2  0
 36 38  1  0
  1 39  1  6
 12 40  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4555697

    ---

Associated Targets(Human)

SOAT2 Tchem Acyl coenzyme A:cholesterol acyltransferase 2 (288 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 529.54Molecular Weight (Monoisotopic): 529.1948AlogP: 2.73#Rotatable Bonds: 6
Polar Surface Area: 151.46Molecular Species: NEUTRALHBA: 11HBD: 1
#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.86CX Basic pKa: 4.21CX LogP: 0.11CX LogD: 0.11
Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.43Np Likeness Score: 1.24

References

1.  (2016)  Class of tricyclic analogue, preparation method and use thereof, 
2. Bhattacharjee P, Rutland N, Iyer MR..  (2022)  Targeting Sterol O-Acyltransferase/Acyl-CoA:Cholesterol Acyltransferase (ACAT): A Perspective on Small-Molecule Inhibitors and Their Therapeutic Potential.,  65  (24.0): [PMID:36473091] [10.1021/acs.jmedchem.2c01265]