(S)-N-(3-amino-1-cyano-3-oxopropyl)-3-((4'-(tert-butyl-[1,1'-biphenyl]-4-yl)sulphonyl)-2,2-dimethylpropanamide

ID: ALA4555719

PubChem CID: 155556864

Max Phase: Preclinical

Molecular Formula: C25H31N3O4S

Molecular Weight: 469.61

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)(CS(=O)(=O)c1ccc(-c2ccc(C(C)(C)C)cc2)cc1)C(=O)N[C@H](C#N)CC(N)=O

Standard InChI:  InChI=1S/C25H31N3O4S/c1-24(2,3)19-10-6-17(7-11-19)18-8-12-21(13-9-18)33(31,32)16-25(4,5)23(30)28-20(15-26)14-22(27)29/h6-13,20H,14,16H2,1-5H3,(H2,27,29)(H,28,30)/t20-/m0/s1

Standard InChI Key:  YMFHUSHJZRFAAW-FQEVSTJZSA-N

Molfile:  

 
     RDKit          2D

 33 34  0  0  0  0  0  0  0  0999 V2000
    9.5050  -25.8365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6766  -25.1307    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0894  -25.8406    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.4978  -25.1282    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8575  -27.4914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8564  -28.3110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5644  -28.7199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2741  -28.3105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2713  -27.4878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5627  -27.0826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9744  -27.0779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6839  -27.4855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3896  -27.0749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3870  -26.2569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6728  -25.8511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9700  -26.2640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8024  -26.2496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2178  -26.2458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2200  -27.0630    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9244  -25.8353    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.6332  -26.2419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5008  -25.0193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2108  -25.4237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3398  -25.8314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0413  -25.4198    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.6354  -27.0591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3443  -27.4658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3465  -28.2830    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.0509  -27.0552    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1484  -28.7190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4410  -28.3098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1477  -29.5362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4351  -29.1217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0
  4  3  2  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  9 11  1  0
 14  3  1  0
  3 17  1  0
 17  1  1  0
  1 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
  1 22  1  0
  1 23  1  0
 21 24  1  0
 24 25  3  0
 21 26  1  6
 26 27  1  0
 27 28  1  0
 27 29  2  0
  6 30  1  0
 30 31  1  0
 30 32  1  0
 30 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4555719

    ---

Associated Targets(Human)

LGMN Tchem Legumain (255 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 469.61Molecular Weight (Monoisotopic): 469.2035AlogP: 3.33#Rotatable Bonds: 8
Polar Surface Area: 130.12Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 11.38CX Basic pKa: CX LogP: 3.04CX LogD: 3.04
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.61Np Likeness Score: -0.91

References

1. Eddie SL, Gregson A, Graham E, Burton S, Harrison T, Burden R, Scott CJ, Mullan PB, Williams R..  (2019)  Identification and SAR exploration of a novel series of Legumain inhibitors.,  29  (12): [PMID:31005445] [10.1016/j.bmcl.2019.03.019]

Source