The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-(4-Benzyl-5-(4-methoxyphenethyl)-4H-1,2,4-triazol-3-yl)phenoxy)-N-(1-methyl-1H-pyrazol-4-yl)propanamide ID: ALA4555739
PubChem CID: 155557030
Max Phase: Preclinical
Molecular Formula: C31H32N6O3
Molecular Weight: 536.64
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CCc2nnc(-c3ccc(OC(C)C(=O)Nc4cnn(C)c4)cc3)n2Cc2ccccc2)cc1
Standard InChI: InChI=1S/C31H32N6O3/c1-22(31(38)33-26-19-32-36(2)21-26)40-28-16-12-25(13-17-28)30-35-34-29(37(30)20-24-7-5-4-6-8-24)18-11-23-9-14-27(39-3)15-10-23/h4-10,12-17,19,21-22H,11,18,20H2,1-3H3,(H,33,38)
Standard InChI Key: PFIUMAIHXAULFH-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
7.2604 -4.2545 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9349 -3.7925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7039 -3.0082 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8865 -2.9855 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6126 -3.7558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8287 -3.9868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2406 -5.0699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5232 -5.4611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8279 -5.0311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1110 -5.4217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0906 -6.2395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7932 -6.6652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5073 -6.2722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7027 -4.0656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8493 -4.8707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6184 -5.1447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2416 -4.6147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0905 -3.8073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3215 -3.5370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0118 -4.8876 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6333 -4.3570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4036 -4.6299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0251 -4.0993 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5524 -5.4335 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2368 -3.4234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4529 -3.6543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8630 -3.0897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0798 -3.3201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8872 -4.1152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4840 -4.6796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2650 -4.4462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1037 -4.3472 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5110 -3.7846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7953 -4.3722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0282 -5.1530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8451 -5.1746 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.1180 -4.4042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4698 -3.9068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9016 -4.1722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4845 -3.5535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 1 1 0
5 6 1 0
1 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
2 14 1 0
17 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
22 24 2 0
6 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
29 32 1 0
32 33 1 0
23 34 1 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 1 0
38 34 2 0
37 39 1 0
21 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 536.64Molecular Weight (Monoisotopic): 536.2536AlogP: 4.93#Rotatable Bonds: 11Polar Surface Area: 96.09Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.54CX Basic pKa: 2.58CX LogP: 4.86CX LogD: 4.86Aromatic Rings: 5Heavy Atoms: 40QED Weighted: 0.26Np Likeness Score: -1.79
References 1. Chen D, Chen Y, Lian F, Chen L, Li Y, Cao D, Wang X, Chen L, Li J, Meng T, Huang M, Geng M, Shen J, Zhang N, Xiong B.. (2019) Fragment-based drug discovery of triazole inhibitors to block PDEδ-RAS protein-protein interaction., 163 [PMID:30562696 ] [10.1016/j.ejmech.2018.12.018 ]