The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(Pyridin-3-yl)-N-(7-(4-(pyridin-3-yl)-1H-1,2,3-triazol-1-yl)heptyl)benzamide ID: ALA4555764
PubChem CID: 86305867
Max Phase: Preclinical
Molecular Formula: C26H28N6O
Molecular Weight: 440.55
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCCCCCCCn1cc(-c2cccnc2)nn1)c1ccccc1-c1cccnc1
Standard InChI: InChI=1S/C26H28N6O/c33-26(24-13-5-4-12-23(24)21-10-8-14-27-18-21)29-16-6-2-1-3-7-17-32-20-25(30-31-32)22-11-9-15-28-19-22/h4-5,8-15,18-20H,1-3,6-7,16-17H2,(H,29,33)
Standard InChI Key: UIYYIDXXCWHXEC-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
17.8089 -21.5084 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.6244 -21.5096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0313 -20.8051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6239 -20.0990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8054 -20.1018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4021 -20.8069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8516 -20.8021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3318 -21.4633 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.1091 -21.2110 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.1093 -20.3937 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.3321 -20.1411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8124 -19.9799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5235 -20.3826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2278 -19.9681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9389 -20.3708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6431 -19.9563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3542 -20.3590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0585 -19.9445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7696 -20.3472 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.4739 -19.9327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1850 -20.3354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4671 -19.1155 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.1889 -21.1531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8992 -21.5557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6044 -21.1412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5949 -20.3198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8841 -19.9209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8728 -19.1068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5772 -18.6904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5679 -17.8741 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.8548 -17.4731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1497 -17.8945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1625 -18.7094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 7 2 0
3 7 1 0
10 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
21 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 21 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
27 28 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 440.55Molecular Weight (Monoisotopic): 440.2325AlogP: 4.78#Rotatable Bonds: 11Polar Surface Area: 85.59Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 4.73CX LogP: 4.05CX LogD: 4.05Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.34Np Likeness Score: -1.37
References 1. Travelli C, Aprile S, Mattoteia D, Colombo G, Clemente N, Scanziani E, Terrazzino S, Alisi MA, Polenzani L, Grosa G, Genazzani AA, Tron GC, Galli U.. (2019) Identification of potent triazolylpyridine nicotinamide phosphoribosyltransferase (NAMPT) inhibitors bearing a 1,2,3-triazole tail group., 181 [PMID:31400709 ] [10.1016/j.ejmech.2019.111576 ]