The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N2,N3-bis(4-chloro-3-(trifluoromethyl)phenyl)quinoxaline-2,3-diamine ID: ALA4555777
PubChem CID: 118656851
Max Phase: Preclinical
Molecular Formula: C22H12Cl2F6N4
Molecular Weight: 517.26
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: FC(F)(F)c1cc(Nc2nc3ccccc3nc2Nc2ccc(Cl)c(C(F)(F)F)c2)ccc1Cl
Standard InChI: InChI=1S/C22H12Cl2F6N4/c23-15-7-5-11(9-13(15)21(25,26)27)31-19-20(34-18-4-2-1-3-17(18)33-19)32-12-6-8-16(24)14(10-12)22(28,29)30/h1-10H,(H,31,33)(H,32,34)
Standard InChI Key: BTJNCZHLHPPYJX-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
7.2321 -14.0502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2309 -14.8776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9457 -15.2905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9439 -13.6374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6593 -14.0466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6581 -14.8750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3711 -15.2881 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0898 -14.8771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0910 -14.0486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3734 -13.6310 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8031 -15.2916 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8065 -13.6378 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8084 -12.8128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5261 -12.4038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5284 -11.5796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8144 -11.1646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0965 -11.5797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0977 -12.4026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8008 -16.1166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0858 -16.5228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0832 -17.3471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7971 -17.7624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5151 -17.3475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5142 -16.5246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2441 -11.1692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9574 -11.5837 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.2465 -10.3442 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.9544 -10.7501 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.2299 -17.7594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2305 -18.5844 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.9440 -17.3464 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.9419 -18.1711 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.8153 -10.3395 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
10.7959 -18.5873 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
8 11 1 0
9 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
11 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
15 25 1 0
25 26 1 0
25 27 1 0
25 28 1 0
23 29 1 0
29 30 1 0
29 31 1 0
29 32 1 0
16 33 1 0
22 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 517.26Molecular Weight (Monoisotopic): 516.0343AlogP: 8.46#Rotatable Bonds: 4Polar Surface Area: 49.84Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.85CX Basic pKa: 2.19CX LogP: 8.33CX LogD: 8.33Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.27Np Likeness Score: -1.04
References 1. (2017) Aryl amine substituted quinoxaline used as anticancer drugs,