The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(2-(((1r,4r)-4-aminocyclohexyl)amino)-6-((2-(morpholinomethyl)phenyl)amino)-9H-purin-9-yl)propan-1-ol ID: ALA4555892
PubChem CID: 155557135
Max Phase: Preclinical
Molecular Formula: C25H36N8O2
Molecular Weight: 480.62
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: N[C@H]1CC[C@H](Nc2nc(Nc3ccccc3CN3CCOCC3)c3ncn(CCCO)c3n2)CC1
Standard InChI: InChI=1S/C25H36N8O2/c26-19-6-8-20(9-7-19)28-25-30-23(22-24(31-25)33(17-27-22)10-3-13-34)29-21-5-2-1-4-18(21)16-32-11-14-35-15-12-32/h1-2,4-5,17,19-20,34H,3,6-16,26H2,(H2,28,29,30,31)/t19-,20-
Standard InChI Key: MGAMZJJELGBKHX-MXVIHJGJSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
14.0085 -23.9076 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.0074 -24.7340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7178 -25.1444 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7160 -23.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4312 -23.9040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4314 -24.7295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2169 -24.9831 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.7037 -24.3142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2165 -23.6458 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2928 -25.1435 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7136 -22.6690 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.4266 -22.2569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1399 -22.6672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8525 -22.2558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8505 -21.4308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1300 -21.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4204 -21.4368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5789 -24.7329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5834 -23.9091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8736 -23.4946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1565 -23.9046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1539 -24.7297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8683 -25.1447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4442 -23.4872 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7033 -21.0278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6973 -20.2037 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.4102 -19.7951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4062 -18.9746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6908 -18.5618 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.9819 -18.9799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9842 -19.8066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2090 -25.8043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9192 -26.2253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6374 -25.8180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3476 -26.2391 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
2 10 1 0
4 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
18 10 1 6
18 19 1 0
18 23 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
21 24 1 1
17 25 1 0
25 26 1 0
26 27 1 0
26 31 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
7 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 480.62Molecular Weight (Monoisotopic): 480.2961AlogP: 2.47#Rotatable Bonds: 9Polar Surface Area: 126.38Molecular Species: BASEHBA: 10HBD: 4#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.75CX Basic pKa: 10.45CX LogP: 1.51CX LogD: -1.28Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.37Np Likeness Score: -1.39
References 1. Řezníčková E, Gucký T, Kováčová V, Ajani H, Jorda R, Kryštof V.. (2019) Activity of 2,6,9-trisubstituted purines as potent PDGFRα kinase inhibitors with antileukaemic activity., 182 [PMID:31514019 ] [10.1016/j.ejmech.2019.111663 ]