Arclyside B

ID: ALA4555921

PubChem CID: 155557253

Max Phase: Preclinical

Molecular Formula: C19H26O10

Molecular Weight: 414.41

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@](O)(CC(=O)O)CC(=O)O[C@@H]1[C@@H](O)[C@H](OCc2ccccc2)O[C@H](CO)[C@H]1O

Standard InChI:  InChI=1S/C19H26O10/c1-19(26,7-13(21)22)8-14(23)29-17-15(24)12(9-20)28-18(16(17)25)27-10-11-5-3-2-4-6-11/h2-6,12,15-18,20,24-26H,7-10H2,1H3,(H,21,22)/t12-,15-,16-,17+,18-,19+/m1/s1

Standard InChI Key:  VGRREJRECURIKP-GNGZPWGXSA-N

Molfile:  

 
     RDKit          2D

 29 30  0  0  0  0  0  0  0  0999 V2000
   19.3030  -17.8214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3030  -18.6427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0125  -19.0472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7219  -18.6427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7219  -17.8214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0125  -17.4045    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.4349  -17.4107    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.1455  -17.8255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8586  -17.4149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4331  -19.0523    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.0125  -19.8685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.5918  -19.0523    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.5900  -17.4107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5876  -16.5894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.5659  -17.8332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2744  -17.4233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2772  -16.6011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5657  -16.1906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8561  -16.5988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3006  -20.2812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3006  -21.1025    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.5888  -19.8685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8811  -20.2812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1692  -19.8685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4574  -20.2812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7456  -19.8685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.4574  -21.1025    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.4623  -20.9870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.2836  -20.9870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  1  1
  7  8  1  0
  8  9  1  0
  4 10  1  6
  3 11  1  1
  2 12  1  6
  1 13  1  1
 13 14  1  0
  9 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19  9  1  0
 11 20  1  0
 20 21  2  0
 20 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  2  0
 23 28  1  1
 23 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4555921

    ---

Associated Targets(non-human)

Si Sucrase-isomaltase (908 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 414.41Molecular Weight (Monoisotopic): 414.1526AlogP: -0.83#Rotatable Bonds: 9
Polar Surface Area: 162.98Molecular Species: ACIDHBA: 9HBD: 5
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 3.74CX Basic pKa: CX LogP: -0.65CX LogD: -3.94
Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.32Np Likeness Score: 1.82

References

1. Thao NP, Luyen BT, Vinh le B, Lee JY, Kwon YI, Kim YH..  (2016)  Rat intestinal sucrase inhibited by minor constituents from the leaves and twigs of Archidendron clypearia (Jack.) Nielsen.,  26  (17): [PMID:27481560] [10.1016/j.bmcl.2016.07.044]

Source