The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-hydroxy-3-(3-methoxy-4-(2-(1-(4-methoxyphenyl)-9H-pyrido[3,4-b]indol-3-ylamino)ethoxy)phenyl)acrylamide ID: ALA4555936
PubChem CID: 155557341
Max Phase: Preclinical
Molecular Formula: C30H28N4O5
Molecular Weight: 524.58
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2nc(NCCOc3ccc(/C=C/C(=O)NO)cc3OC)cc3c2[nH]c2ccccc23)cc1
Standard InChI: InChI=1S/C30H28N4O5/c1-37-21-11-9-20(10-12-21)29-30-23(22-5-3-4-6-24(22)32-30)18-27(33-29)31-15-16-39-25-13-7-19(17-26(25)38-2)8-14-28(35)34-36/h3-14,17-18,32,36H,15-16H2,1-2H3,(H,31,33)(H,34,35)/b14-8+
Standard InChI Key: ZTZXPNUEFFOZFT-RIYZIHGNSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
5.7655 -5.2814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4793 -4.8678 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4764 -4.0410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7637 -3.6358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7671 -6.1005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0536 -6.5084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0530 -7.3289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7653 -7.7426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4796 -7.3257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4766 -6.5065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0533 -4.8683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0500 -4.0477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2778 -5.1278 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7910 -4.4651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2732 -3.8030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9381 -3.0579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1252 -2.9738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6485 -3.6408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9821 -4.3832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7662 -8.5640 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0548 -8.9733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1867 -3.6298 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9001 -4.0357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6104 -3.6245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3237 -4.0304 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0340 -3.6191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7393 -4.0268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4491 -3.6162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4465 -2.7940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7281 -2.3842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0254 -2.8012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1562 -2.3777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8701 -2.7868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5799 -2.3705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2938 -2.7796 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.5757 -1.5492 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2979 -3.6009 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7404 -4.8481 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0333 -5.2618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 12 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
1 5 1 0
11 12 2 0
12 15 1 0
14 13 1 0
13 11 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
8 20 1 0
20 21 1 0
3 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
29 32 1 0
32 33 2 0
33 34 1 0
34 35 1 0
34 36 2 0
35 37 1 0
27 38 1 0
38 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 524.58Molecular Weight (Monoisotopic): 524.2060AlogP: 5.41#Rotatable Bonds: 10Polar Surface Area: 117.73Molecular Species: NEUTRALHBA: 7HBD: 4#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.56CX Basic pKa: 5.96CX LogP: 4.65CX LogD: 4.64Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.08Np Likeness Score: -0.28
References 1. Ling Y, Li Y, Zhu R, Qian J, Liu J, Gao W, Meng C, Miao J, Xiong B, Qiu X, Ling C, Dai H, Zhang Y.. (2019) Hydroxamic Acid Derivatives of β-Carboline/Hydroxycinnamic Acid Hybrids Inducing Apoptosis and Autophagy through the PI3K/Akt/mTOR Pathways., 82 (6): [PMID:31120744 ] [10.1021/acs.jnatprod.8b00843 ]