Quafrinoic acid

ID: ALA4555998

PubChem CID: 21672630

Max Phase: Preclinical

Molecular Formula: C30H44O5

Molecular Weight: 484.68

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@H]1[C@H](C)CC[C@]2(C(=O)O)CC[C@]3(C(=O)O)C(=CC[C@@H]4[C@@]5(C)CCC(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@H]12

Standard InChI:  InChI=1S/C30H44O5/c1-17-9-14-29(24(32)33)15-16-30(25(34)35)19(23(29)18(17)2)7-8-21-27(5)12-11-22(31)26(3,4)20(27)10-13-28(21,30)6/h7,17-18,20-21,23H,8-16H2,1-6H3,(H,32,33)(H,34,35)/t17-,18+,20+,21-,23+,27+,28-,29+,30-/m1/s1

Standard InChI Key:  FMSFBVNDANCOGZ-UTNBSYOWSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
    8.3395  -13.4996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1726  -17.9274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7648  -17.2200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3566  -17.9247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0677  -13.0918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1880  -14.7439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9033  -14.3277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6186  -14.7439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6151  -15.5720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3271  -15.9888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0472  -15.5781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9033  -15.9840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1880  -15.5720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1944  -17.2169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9096  -16.8057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4791  -16.8092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4819  -15.9833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7714  -15.5682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0578  -15.9786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3342  -14.3326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0507  -14.7548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7685  -14.3511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7801  -13.5196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0528  -16.8006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4764  -15.1517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8954  -15.1559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6071  -16.3960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7586  -15.1683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4766  -14.7528    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.7579  -15.9965    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3409  -17.2083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7606  -16.3960    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.1839  -16.3960    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.3270  -15.1559    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.0802  -12.2680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3166  -16.8148    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3907  -17.1908    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6300  -13.0807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  1  0
  3  4  1  0
  6 13  1  0
  6  7  1  0
 12  9  1  0
  8  7  2  0
  8  9  1  0
  8 20  1  0
  9 10  1  0
 10 11  1  0
 11 21  1  0
 12 13  1  0
 12 15  1  0
 13 17  1  0
 16 14  1  0
 14 15  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 24  1  0
 20 21  1  0
 20  1  1  0
 21 22  1  0
 22 23  1  0
 23  5  1  0
  5  1  1  0
 17 25  1  1
 12 26  1  1
  9 27  1  6
 21 28  1  1
 28 29  2  0
 28 30  1  0
 24  3  1  0
 16  3  1  0
 24 31  2  0
 16 32  1  6
 13 33  1  6
 20 34  1  1
  5 35  1  6
 27 36  1  0
 27 37  2  0
  1 38  1  1
M  END

Alternative Forms

Associated Targets(non-human)

Haemophilus influenzae (8812 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 484.68Molecular Weight (Monoisotopic): 484.3189AlogP: 6.36#Rotatable Bonds: 2
Polar Surface Area: 91.67Molecular Species: ACIDHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.20CX Basic pKa: CX LogP: 6.34CX LogD: 0.77
Aromatic Rings: Heavy Atoms: 35QED Weighted: 0.44Np Likeness Score: 2.98

References

1. Kezetas Bankeu JJ, Kenou Kagho DU, Fotsing Fongang YS, Kouipou Toghueo RM, Mba'ning BM, Tchouya Feuya GR, Boyom Fekam F, Tchouankeu JC, Ngouela SA, Sewald N, Lenta BN, Ali MS..  (2019)  Constituents from Nauclea latifolia with Anti-Haemophilus influenzae Type b Inhibitory Activities.,  82  (9): [PMID:31429278] [10.1021/acs.jnatprod.9b00463]

Source