5-chloro-2-(2-(4-(4-chlorophenyl)-1,4-diazepan-1-yl)ethyl)-1H-inden-1-one

ID: ALA4556093

PubChem CID: 155556668

Max Phase: Preclinical

Molecular Formula: C22H22Cl2N2O

Molecular Weight: 401.34

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1C(CCN2CCCN(c3ccc(Cl)cc3)CC2)=Cc2cc(Cl)ccc21

Standard InChI:  InChI=1S/C22H22Cl2N2O/c23-18-2-5-20(6-3-18)26-10-1-9-25(12-13-26)11-8-16-14-17-15-19(24)4-7-21(17)22(16)27/h2-7,14-15H,1,8-13H2

Standard InChI Key:  ZPZUHCZXEFEFGB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
   19.0421  -16.2652    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.4455  -15.5554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2590  -15.4297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3416  -17.0300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8659  -15.9838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1290  -17.2676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8057  -16.8018    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.5193  -17.2074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5193  -18.0258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2279  -18.4354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9390  -18.0197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9329  -17.1942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2196  -16.7923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2176  -16.2572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7980  -16.9650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9767  -16.9570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4949  -16.2861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4820  -17.6165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7073  -17.3524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7166  -16.5343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0134  -16.1211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3003  -16.5207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2950  -17.3419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9988  -17.7555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7563  -15.5063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.6531  -18.4285    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   13.5806  -17.7501    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  1  4  1  0
  3  5  1  0
  4  6  1  0
  5  7  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  1 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 20  1  0
 19 18  1  0
 18 16  2  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 17 25  2  0
 11 26  1  0
 23 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4556093

    ---

Associated Targets(Human)

SIGMAR1 Tclin Sigma opioid receptor (6358 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 401.34Molecular Weight (Monoisotopic): 400.1109AlogP: 5.18#Rotatable Bonds: 4
Polar Surface Area: 23.55Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.41CX LogP: 5.04CX LogD: 3.99
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.71Np Likeness Score: -0.77

References

1. Asong G, Zhu XY, Bricker B, Andey T, Amissah F, Lamango N, Ablordeppey SY..  (2019)  New analogs of SYA013 as sigma-2 ligands with anticancer activity.,  27  (12): [PMID:30987780] [10.1016/j.bmc.2019.04.012]

Source