(S)-N-(3-amino-1-cyano-3-oxopropyl)-3-(((benzo[d]thiazol-6-yl)phenyl)sulphonyl)-2,2-dimethylpropanamide

ID: ALA4556228

PubChem CID: 155557380

Max Phase: Preclinical

Molecular Formula: C22H22N4O4S2

Molecular Weight: 470.58

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)(CS(=O)(=O)c1ccccc1-c1ccc2ncsc2c1)C(=O)N[C@H](C#N)CC(N)=O

Standard InChI:  InChI=1S/C22H22N4O4S2/c1-22(2,21(28)26-15(11-23)10-20(24)27)12-32(29,30)19-6-4-3-5-16(19)14-7-8-17-18(9-14)31-13-25-17/h3-9,13,15H,10,12H2,1-2H3,(H2,24,27)(H,26,28)/t15-/m0/s1

Standard InChI Key:  GIQMBMSZUMJEOK-HNNXBMFYSA-N

Molfile:  

 
     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
    5.2870  -24.4002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4462  -23.6903    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8631  -24.4043    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.2715  -23.6878    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7357  -25.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4494  -26.0575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1592  -25.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1566  -24.8247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4382  -24.4148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7313  -24.8319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5802  -24.8175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0039  -24.8136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0061  -25.6350    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7105  -24.3990    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4234  -24.8098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2828  -23.5789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9969  -23.9875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1342  -24.3951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8398  -23.9835    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4257  -25.6311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1386  -26.0377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1408  -26.8591    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8493  -25.6272    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8677  -26.0541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8661  -26.8693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2774  -26.0449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5691  -25.6415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2817  -26.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5727  -27.2818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7487  -28.0844    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.5665  -28.1651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8957  -27.4123    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0
  4  3  2  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  8  3  1  0
  3 11  1  0
 11  1  1  0
  1 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  1  0
  1 16  1  0
  1 17  1  0
 15 18  1  0
 18 19  3  0
 15 20  1  6
 20 21  1  0
 21 22  1  0
 21 23  2  0
  7 24  1  0
 24 25  2  0
 25 29  1  0
 28 26  1  0
 26 27  2  0
 27 24  1  0
 28 29  2  0
 29 30  1  0
 30 31  1  0
 31 32  2  0
 32 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4556228

    ---

Associated Targets(Human)

LGMN Tchem Legumain (255 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 470.58Molecular Weight (Monoisotopic): 470.1082AlogP: 2.65#Rotatable Bonds: 8
Polar Surface Area: 143.01Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 11.53CX Basic pKa: 2.14CX LogP: 1.64CX LogD: 1.64
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.52Np Likeness Score: -1.08

References

1. Eddie SL, Gregson A, Graham E, Burton S, Harrison T, Burden R, Scott CJ, Mullan PB, Williams R..  (2019)  Identification and SAR exploration of a novel series of Legumain inhibitors.,  29  (12): [PMID:31005445] [10.1016/j.bmcl.2019.03.019]

Source