The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4,6-dimethyl-5-phenyl-2-{[4-(o-methoxyphenyl)-1-piperazinyl]methyl}pyrrolo[3,4-c]pyrrole-1,3(2H,5H)-dione ID: ALA4556356
PubChem CID: 155557383
Max Phase: Preclinical
Molecular Formula: C26H28N4O3
Molecular Weight: 444.54
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccccc1N1CCN(CN2C(=O)c3c(c(C)n(-c4ccccc4)c3C)C2=O)CC1
Standard InChI: InChI=1S/C26H28N4O3/c1-18-23-24(19(2)30(18)20-9-5-4-6-10-20)26(32)29(25(23)31)17-27-13-15-28(16-14-27)21-11-7-8-12-22(21)33-3/h4-12H,13-17H2,1-3H3
Standard InChI Key: PTNGQUVJNJDFSL-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
32.8461 -12.3473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8850 -11.0118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3835 -11.6657 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.6640 -11.2909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6379 -12.1155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4140 -12.3953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9200 -11.7435 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.4564 -11.0610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7361 -10.2849 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.6439 -13.1876 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.5672 -13.1236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6521 -10.2204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7445 -11.7697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1341 -12.4968 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.6926 -13.1978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0788 -13.9227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9035 -13.9531 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.3406 -13.2523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9530 -12.5211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2900 -14.6772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8506 -15.3768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2369 -16.1048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0621 -16.1346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4997 -15.4302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1111 -14.7050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5594 -11.6427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1685 -10.9150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3447 -10.8907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9108 -11.5934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3069 -12.3220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1294 -12.3427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5467 -14.0045 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.3712 -14.0314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 5 2 0
4 2 2 0
2 3 1 0
3 1 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 4 1 0
8 9 2 0
6 10 2 0
1 11 1 0
2 12 1 0
7 13 1 0
13 14 1 0
14 15 1 0
14 19 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
17 20 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
3 26 1 0
25 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 444.54Molecular Weight (Monoisotopic): 444.2161AlogP: 3.48#Rotatable Bonds: 5Polar Surface Area: 58.02Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.25CX LogP: 3.99CX LogD: 3.98Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.56Np Likeness Score: -1.21
References 1. Redzicka A, Szczukowski Ł, Kochel A, Wiatrak B, Gębczak K, Czyżnikowska Ż.. (2019) COX-1/COX-2 inhibition activities and molecular docking study of newly designed and synthesized pyrrolo[3,4-c]pyrrole Mannich bases., 27 (17): [PMID:31345747 ] [10.1016/j.bmc.2019.07.033 ]