benzyl (S)-1-((S)-1-((S)-1-(benzylamino)-5-methyl-1,2-dioxohexan-3-ylamino)-4-methyl-1-oxopentan-2-ylamino)-4-methyl-1-oxopentan-2-ylcarbamate

ID: ALA4556452

PubChem CID: 11700022

Max Phase: Preclinical

Molecular Formula: C34H48N4O6

Molecular Weight: 608.78

Molecule Type: Unknown

Names and Identifiers

Canonical SMILES:  CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)C(=O)NCc1ccccc1

Standard InChI:  InChI=1S/C34H48N4O6/c1-22(2)17-27(30(39)33(42)35-20-25-13-9-7-10-14-25)36-31(40)28(18-23(3)4)37-32(41)29(19-24(5)6)38-34(43)44-21-26-15-11-8-12-16-26/h7-16,22-24,27-29H,17-21H2,1-6H3,(H,35,42)(H,36,40)(H,37,41)(H,38,43)/t27-,28-,29-/m0/s1

Standard InChI Key:  JZIKIPGYXCRVNC-AWCRTANDSA-N

Molfile:  

 
     RDKit          2D

 44 45  0  0  0  0  0  0  0  0999 V2000
    3.1792  -11.0209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8937  -10.6084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6081  -11.0209    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3226  -10.6084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0371  -11.0209    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3226   -9.7834    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7515  -10.6084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4660  -11.0209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8442   -9.7884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4660  -11.8459    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1805  -10.6084    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5976   -9.4495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2670   -9.9318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6807   -8.6286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8949  -11.0209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6095  -10.6084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8949  -11.8459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3240  -11.0209    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6095   -9.7834    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4750  -12.4251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2621  -13.2221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1528  -12.2704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0384  -10.6084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7529  -11.0209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0384   -9.7834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7529   -9.3709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3240   -9.3709    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4674   -9.7834    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7529   -8.5458    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.4674   -8.1333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1818   -8.5458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1765   -9.3720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8901   -9.7844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6055   -9.3719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6029   -8.5426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8887   -8.1338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4651  -10.6054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7512  -11.0172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7508  -11.8432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4702  -12.2555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1812  -11.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7529  -11.8459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4674  -12.2584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0384  -12.2584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  4  6  2  0
  5  7  1  0
  7  8  1  0
  7  9  1  1
  8 10  2  0
  8 11  1  0
  9 12  1  0
 12 13  1  0
 12 14  1  0
 11 15  1  0
 15 16  1  0
 15 17  1  6
 16 18  1  0
 16 19  2  0
 17 20  1  0
 20 21  1  0
 20 22  1  0
 18 23  1  0
 23 24  1  0
 23 25  1  6
 25 26  1  0
 25 27  2  0
 26 28  2  0
 26 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
  1 37  2  0
 37 38  1  0
 38 39  2  0
 39 40  1  0
 40 41  2  0
 41  1  1  0
 24 42  1  0
 42 43  1  0
 42 44  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4556452

   benzyl N-[(2S)-1-[[(2S)-1-[[(3S)-1-(benzylamino)-5-methyl-1,2-dioxohexan-3-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 608.78

Molecular Weight (Monoisotopic): 608.3574

AlogP: 4.27

#Rotatable Bonds: 17

Polar Surface Area: 142.70

Molecular Species: NEUTRAL

HBA: 6

HBD: 4

#RO5 Violations: 1

HBA (Lipinski): 10

HBD (Lipinski): 4

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 12.05

CX Basic pKa: ┄

CX LogP: 5.70

CX LogD: 5.70

Aromatic Rings: 2

Heavy Atoms: 44

QED Weighted: 0.20

Np Likeness Score: -0.31

References

1. Pacifico S, Ferretti V, Albanese V, Fantinati A, Gallerani E, Nicoli F, Gavioli R, Zamberlan F, Preti D, Marastoni M..  (2019)  Synthesis and Biological Activity of Peptide α-Ketoamide Derivatives as Proteasome Inhibitors.,  10  (7): [PMID:31312413] [10.1021/acsmedchemlett.9b00233]

Source

Source(1):

• Scientific Literature