N1-methyl-N2-(16-oxo-16-(phenylsulfonamido)hexadec-5(Z)-en-1-yl)oxalamide

ID: ALA4556490

PubChem CID: 118265265

Max Phase: Preclinical

Molecular Formula: C25H39N3O5S

Molecular Weight: 493.67

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CNC(=O)C(=O)NCCCC/C=C\CCCCCCCCCC(=O)NS(=O)(=O)c1ccccc1

Standard InChI:  InChI=1S/C25H39N3O5S/c1-26-24(30)25(31)27-21-17-12-10-8-6-4-2-3-5-7-9-11-16-20-23(29)28-34(32,33)22-18-14-13-15-19-22/h6,8,13-15,18-19H,2-5,7,9-12,16-17,20-21H2,1H3,(H,26,30)(H,27,31)(H,28,29)/b8-6-

Standard InChI Key:  IRTMWDUCNYHBOD-VURMDHGXSA-N

Molfile:  

 
     RDKit          2D

 34 34  0  0  0  0  0  0  0  0999 V2000
   36.9139  -12.0020    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.2082  -12.4147    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   36.9185  -12.8195    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.5349  -14.5402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3521  -14.5402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1263  -15.2479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3092  -15.2479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9006  -15.9556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3092  -16.6634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7607  -15.2479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5779  -15.2479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1263  -16.6634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5349  -15.9556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3521  -15.9556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7607  -16.6634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5779  -16.6634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9865  -17.3711    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.8037  -17.3711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2123  -18.0788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2123  -16.6634    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.0295  -18.0788    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.4381  -18.7865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9865  -14.5402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8037  -14.5402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2123  -13.8325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0295  -13.8325    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.8037  -13.1248    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.8037  -18.7865    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.8037  -11.7094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2150  -11.0025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8071  -10.2953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9890  -10.2949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5806  -11.0075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9908  -11.7118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  4  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  5 10  1  0
 10 11  1  0
  9 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  1  0
 21 22  1  0
 11 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 25 27  1  0
 19 28  2  0
 27  2  1  0
  2 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
M  END

Associated Targets(Human)

EPHX2 Tchem Epoxide hydratase (3844 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 493.67Molecular Weight (Monoisotopic): 493.2610AlogP: 3.59#Rotatable Bonds: 17
Polar Surface Area: 121.44Molecular Species: ACIDHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 4.24CX Basic pKa: CX LogP: 4.34CX LogD: 3.40
Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.17Np Likeness Score: -0.41

References

1. Adebesin AM, Wesser T, Vijaykumar J, Konkel A, Paudyal MP, Lossie J, Zhu C, Westphal C, Puli N, Fischer R, Schunck WH, Falck JR..  (2019)  Development of Robust 17(R),18(S)-Epoxyeicosatetraenoic Acid (17,18-EEQ) Analogues as Potential Clinical Antiarrhythmic Agents.,  62  (22): [PMID:31693857] [10.1021/acs.jmedchem.9b00952]

Source