3-(3-(allyloxy)-4-(3-(3-amino-4,5-dimethoxyphenyl)-3-oxoprop-1-enylamino)phenyl)-N-(3,4,5-trimethoxyphenyl)acrylamide

ID: ALA4556544

PubChem CID: 155557095

Max Phase: Preclinical

Molecular Formula: C32H35N3O8

Molecular Weight: 589.65

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=CCOc1cc(/C=C/C(=O)Nc2cc(OC)c(OC)c(OC)c2)ccc1N/C=C\C(=O)c1cc(N)c(OC)c(OC)c1

Standard InChI:  InChI=1S/C32H35N3O8/c1-7-14-43-26-15-20(9-11-30(37)35-22-18-28(39-3)32(42-6)29(19-22)40-4)8-10-24(26)34-13-12-25(36)21-16-23(33)31(41-5)27(17-21)38-2/h7-13,15-19,34H,1,14,33H2,2-6H3,(H,35,37)/b11-9+,13-12-

Standard InChI Key:  IUDMWPDPELPVOR-ZFDSPDROSA-N

Molfile:  

 
     RDKit          2D

 43 45  0  0  0  0  0  0  0  0999 V2000
   13.1438  -11.5108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1427  -12.3303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8507  -12.7393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5604  -12.3299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5575  -11.5072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8489  -11.1019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4346  -12.7384    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7272  -12.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4360  -11.1024    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4358  -10.2852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8505  -13.5565    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.2637  -11.0959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9729  -11.5019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2606  -10.2788    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.6791  -11.0906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6760  -10.2734    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.3822   -9.8622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0879  -10.2720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7935   -9.8614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7909   -9.0434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0767   -8.6376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3739   -9.0506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0882  -11.0892    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.3806  -11.4981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3809  -12.3153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6734  -12.7241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4965   -8.6312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2063   -9.0362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9119   -8.6240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6217   -9.0290    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.9078   -7.8068    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.3273   -8.6168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0344   -9.0222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7395   -8.6107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7358   -7.7926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0210   -7.3878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3188   -7.8017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0140   -6.5707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.7181   -6.1560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4408   -7.3795    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.1511   -7.7835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4491   -9.0160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.4528   -9.8332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  7  8  1  0
  1  9  1  0
  9 10  1  0
  3 11  1  0
  5 12  1  0
 12 13  1  0
 12 14  2  0
 13 15  2  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 18 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 20 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  1  0
 29 31  2  0
 30 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
 36 38  1  0
 38 39  1  0
 35 40  1  0
 40 41  1  0
 34 42  1  0
 42 43  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4556544

    ---

Associated Targets(Human)

DU-145 (51482 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 589.65Molecular Weight (Monoisotopic): 589.2424AlogP: 5.34#Rotatable Bonds: 15
Polar Surface Area: 139.60Molecular Species: NEUTRALHBA: 10HBD: 3
#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 3
CX Acidic pKa: CX Basic pKa: 2.96CX LogP: 3.68CX LogD: 3.68
Aromatic Rings: 3Heavy Atoms: 43QED Weighted: 0.09Np Likeness Score: -0.48

References

1. Gaikwad N, Nanduri S, Madhavi YV..  (2019)  Cinnamamide: An insight into the pharmacological advances and structure-activity relationships.,  181  [PMID:31376564] [10.1016/j.ejmech.2019.07.064]

Source