The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(3-(allyloxy)-4-(3-(3-amino-4,5-dimethoxyphenyl)-3-oxoprop-1-enylamino)phenyl)-N-(3,4,5-trimethoxyphenyl)acrylamide ID: ALA4556544
PubChem CID: 155557095
Max Phase: Preclinical
Molecular Formula: C32H35N3O8
Molecular Weight: 589.65
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CCOc1cc(/C=C/C(=O)Nc2cc(OC)c(OC)c(OC)c2)ccc1N/C=C\C(=O)c1cc(N)c(OC)c(OC)c1
Standard InChI: InChI=1S/C32H35N3O8/c1-7-14-43-26-15-20(9-11-30(37)35-22-18-28(39-3)32(42-6)29(19-22)40-4)8-10-24(26)34-13-12-25(36)21-16-23(33)31(41-5)27(17-21)38-2/h7-13,15-19,34H,1,14,33H2,2-6H3,(H,35,37)/b11-9+,13-12-
Standard InChI Key: IUDMWPDPELPVOR-ZFDSPDROSA-N
Molfile:
RDKit 2D
43 45 0 0 0 0 0 0 0 0999 V2000
13.1438 -11.5108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1427 -12.3303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8507 -12.7393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5604 -12.3299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5575 -11.5072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8489 -11.1019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4346 -12.7384 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7272 -12.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4360 -11.1024 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4358 -10.2852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8505 -13.5565 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2637 -11.0959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9729 -11.5019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2606 -10.2788 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6791 -11.0906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6760 -10.2734 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.3822 -9.8622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0879 -10.2720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7935 -9.8614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7909 -9.0434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0767 -8.6376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3739 -9.0506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0882 -11.0892 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.3806 -11.4981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3809 -12.3153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6734 -12.7241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4965 -8.6312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2063 -9.0362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9119 -8.6240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6217 -9.0290 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.9078 -7.8068 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.3273 -8.6168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0344 -9.0222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7395 -8.6107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7358 -7.7926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0210 -7.3878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3188 -7.8017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0140 -6.5707 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.7181 -6.1560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4408 -7.3795 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.1511 -7.7835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4491 -9.0160 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.4528 -9.8332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
1 9 1 0
9 10 1 0
3 11 1 0
5 12 1 0
12 13 1 0
12 14 2 0
13 15 2 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
18 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
20 27 1 0
27 28 2 0
28 29 1 0
29 30 1 0
29 31 2 0
30 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
36 38 1 0
38 39 1 0
35 40 1 0
40 41 1 0
34 42 1 0
42 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 589.65Molecular Weight (Monoisotopic): 589.2424AlogP: 5.34#Rotatable Bonds: 15Polar Surface Area: 139.60Molecular Species: NEUTRALHBA: 10HBD: 3#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 3CX Acidic pKa: ┄CX Basic pKa: 2.96CX LogP: 3.68CX LogD: 3.68Aromatic Rings: 3Heavy Atoms: 43QED Weighted: 0.09Np Likeness Score: -0.48
References 1. Gaikwad N, Nanduri S, Madhavi YV.. (2019) Cinnamamide: An insight into the pharmacological advances and structure-activity relationships., 181 [PMID:31376564 ] [10.1016/j.ejmech.2019.07.064 ]