The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S)-methyl 2-(4-((R)-2-amino-3-mercaptopropylamino)-2-(naphthalen-1-yl)benzamido)-4-methylpentanoate 2,2,2-trifluoroacetate ID: ALA4556549
Cas Number: 1217457-86-7
PubChem CID: 16078971
Product Number: G287072, Order Now?
Max Phase: Preclinical
Molecular Formula: C29H34F3N3O5S
Molecular Weight: 479.65
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)[C@H](CC(C)C)NC(=O)c1ccc(NC[C@@H](N)CS)cc1-c1cccc2ccccc12.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C27H33N3O3S.C2HF3O2/c1-17(2)13-25(27(32)33-3)30-26(31)23-12-11-20(29-15-19(28)16-34)14-24(23)22-10-6-8-18-7-4-5-9-21(18)22;3-2(4,5)1(6)7/h4-12,14,17,19,25,29,34H,13,15-16,28H2,1-3H3,(H,30,31);(H,6,7)/t19-,25+;/m1./s1
Standard InChI Key: WALKWJPZELDSKT-UFABNHQSSA-N
Molfile:
RDKit 2D
41 42 0 0 0 0 0 0 0 0999 V2000
7.5370 -9.4810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2376 -9.9152 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5623 -8.6564 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8091 -9.8762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1478 -10.2312 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.0131 -9.5449 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.8334 -10.7603 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.6154 -5.6583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6142 -6.4858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3291 -6.8986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0454 -6.4853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0426 -5.6547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3272 -5.2456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7571 -6.8958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1861 -7.7196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1821 -6.8904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4673 -6.4828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4713 -8.1333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7600 -7.7225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0508 -8.1330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0515 -8.9540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7675 -9.3630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4738 -8.9502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7571 -5.2392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4731 -5.6491 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.7540 -4.4142 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1860 -5.2339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9020 -5.6437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1829 -4.4089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8958 -3.9937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8927 -3.1687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6118 -4.4035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9051 -6.4687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6150 -5.2285 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3309 -5.6383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8994 -6.8977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1852 -6.4846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4705 -6.8966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7563 -6.4834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0415 -6.8954 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.4698 -7.7216 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
4 5 1 0
4 6 1 0
4 7 1 0
1 4 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
14 19 2 0
18 15 2 0
15 16 1 0
16 17 2 0
17 14 1 0
11 14 1 0
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
24 25 1 0
24 26 2 0
12 24 1 0
25 27 1 0
27 28 1 0
27 29 1 1
29 30 1 0
30 31 1 0
30 32 1 0
28 33 2 0
28 34 1 0
34 35 1 0
9 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
38 41 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 479.65Molecular Weight (Monoisotopic): 479.2243AlogP: 4.49#Rotatable Bonds: 10Polar Surface Area: 93.45Molecular Species: BASEHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.25CX Basic pKa: 9.26CX LogP: 4.06CX LogD: 2.45Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.25Np Likeness Score: -0.40
References 1. Marín-Ramos NI, Balabasquer M, Ortega-Nogales FJ, Torrecillas IR, Gil-Ordóñez A, Marcos-Ramiro B, Aguilar-Garrido P, Cushman I, Romero A, Medrano FJ, Gajate C, Mollinedo F, Philips MR, Campillo M, Gallardo M, Martín-Fontecha M, López-Rodríguez ML, Ortega-Gutiérrez S.. (2019) A Potent Isoprenylcysteine Carboxylmethyltransferase (ICMT) Inhibitor Improves Survival in Ras-Driven Acute Myeloid Leukemia., 62 (13): [PMID:31181882 ] [10.1021/acs.jmedchem.9b00145 ] 2. Institute for Molecular Medicine Finland - High Throughput Biomedicine Unit. (2023) ECBD screening data for assay EOS300108, [10.6019/EOS300108 ]