5-(4-(Pyridin-4-yl)-1H-1,2,3-triazol-1-yl)-4'-(piperidin-4-yl)-[1,1'-biphenyl]-3-carboxylic Acid

ID: ALA4556572

PubChem CID: 135356979

Max Phase: Preclinical

Molecular Formula: C25H23N5O2

Molecular Weight: 425.49

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)c1cc(-c2ccc(C3CCNCC3)cc2)cc(-n2cc(-c3ccncc3)nn2)c1

Standard InChI:  InChI=1S/C25H23N5O2/c31-25(32)22-13-21(18-3-1-17(2-4-18)19-5-9-26-10-6-19)14-23(15-22)30-16-24(28-29-30)20-7-11-27-12-8-20/h1-4,7-8,11-16,19,26H,5-6,9-10H2,(H,31,32)

Standard InChI Key:  LJDHETKRPNEOMJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   15.5720   -3.6540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3874   -3.6552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7943   -2.9507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3869   -2.2446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5684   -2.2474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1652   -2.9525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6077   -2.9484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0155   -3.6578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8320   -3.6583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2415   -2.9502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8287   -2.2400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0136   -2.2430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0570   -2.9472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4651   -3.6563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2788   -3.6573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6904   -2.9510    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.2823   -2.2419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4625   -2.2392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1571   -1.5412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5631   -0.8320    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3399   -1.5443    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1641   -4.3656    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.3514   -4.4512    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.1817   -5.2506    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.8896   -5.6591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4966   -5.1120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9737   -6.4691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3110   -6.9492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3963   -7.7612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1436   -8.0941    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.8064   -7.6089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7178   -6.7987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  3  7  1  0
 13 14  1  0
 13 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 10 13  1  0
  5 19  1  0
 19 20  1  0
 19 21  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 22  1  0
  1 22  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 25 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4556572

    ---

Associated Targets(Human)

P2RY14 Tchem Purinergic receptor P2Y14 (692 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 425.49Molecular Weight (Monoisotopic): 425.1852AlogP: 4.16#Rotatable Bonds: 5
Polar Surface Area: 92.93Molecular Species: ZWITTERIONHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 4.00CX Basic pKa: 10.07CX LogP: 1.43CX LogD: 1.43
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.50Np Likeness Score: -0.98

References

1. Junker A, Balasubramanian R, Ciancetta A, Uliassi E, Kiselev E, Martiriggiano C, Trujillo K, Mtchedlidze G, Birdwell L, Brown KA, Harden TK, Jacobson KA..  (2016)  Structure-Based Design of 3-(4-Aryl-1H-1,2,3-triazol-1-yl)-Biphenyl Derivatives as P2Y14 Receptor Antagonists.,  59  (13): [PMID:27331270] [10.1021/acs.jmedchem.6b00044]

Source