The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3-cyano-4,6-bis(4-methoxyphenyl)pyridin-2-ylthio)-N-(2-ethylphenyl)acetamide ID: ALA4556577
PubChem CID: 1727849
Max Phase: Preclinical
Molecular Formula: C30H27N3O3S
Molecular Weight: 509.63
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCc1ccccc1NC(=O)CSc1nc(-c2ccc(OC)cc2)cc(-c2ccc(OC)cc2)c1C#N
Standard InChI: InChI=1S/C30H27N3O3S/c1-4-20-7-5-6-8-27(20)32-29(34)19-37-30-26(18-31)25(21-9-13-23(35-2)14-10-21)17-28(33-30)22-11-15-24(36-3)16-12-22/h5-17H,4,19H2,1-3H3,(H,32,34)
Standard InChI Key: QRGMIAVUMTVLOJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
28.7323 -3.6649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7312 -4.4845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4392 -4.8934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1489 -4.4840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1461 -3.6613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4375 -3.2561 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.0266 -3.2567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0278 -2.4384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3208 -2.0300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6122 -2.4389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6150 -3.2603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3226 -3.6649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8522 -3.2501 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
31.5615 -3.6560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2677 -3.2447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9769 -3.6507 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.2646 -2.4276 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.9800 -4.4679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2738 -4.8768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2765 -5.6932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9863 -6.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6948 -5.6843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6885 -4.8692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4409 -5.7085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7315 -6.1163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7309 -6.9327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4391 -7.3423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1492 -6.9295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1463 -6.1144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8596 -4.8919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5679 -5.2994 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.4400 -8.1595 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.7327 -8.5689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9038 -2.0314 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.9026 -1.2142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3930 -4.4550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1039 -4.8580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
1 7 1 0
5 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
15 17 2 0
16 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
3 24 1 0
30 31 3 0
4 30 1 0
27 32 1 0
32 33 1 0
10 34 1 0
34 35 1 0
23 36 1 0
36 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 509.63Molecular Weight (Monoisotopic): 509.1773AlogP: 6.60#Rotatable Bonds: 9Polar Surface Area: 84.24Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.72CX Basic pKa: ┄CX LogP: 6.76CX LogD: 6.76Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.26Np Likeness Score: -1.51
References 1. Cui W, Lv W, Qu Y, Ma R, Wang YW, Xu YJ, Wu D, Chen X.. (2016) Discovery of 2-((3-cyanopyridin-2-yl)thio)acetamides as human lactate dehydrogenase A inhibitors to reduce the growth of MG-63 osteosarcoma cells: Virtual screening and biological validation., 26 (16): [PMID:27406795 ] [10.1016/j.bmcl.2016.06.083 ]