1-((5-Bromo-4-((4-bromonaphth-1-yl)methyl)-4H-1,2,4-triazol-3-yl)thio)-N-(2,5-dichloropyridin-3-yl)methanesulfonamide

ID: ALA4556590

PubChem CID: 155557315

Max Phase: Preclinical

Molecular Formula: C19H13Br2Cl2N5O2S2

Molecular Weight: 638.19

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=S(=O)(CSc1nnc(Br)n1Cc1ccc(Br)c2ccccc12)Nc1cc(Cl)cnc1Cl

Standard InChI:  InChI=1S/C19H13Br2Cl2N5O2S2/c20-15-6-5-11(13-3-1-2-4-14(13)15)9-28-18(21)25-26-19(28)31-10-32(29,30)27-16-7-12(22)8-24-17(16)23/h1-8,27H,9-10H2

Standard InChI Key:  JGFRZAIZMKGLPN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   13.4424  -18.3744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8551  -19.0843    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   14.2635  -18.3719    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5296  -21.5553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8161  -21.9674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8158  -22.7879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5281  -23.1973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2392  -21.9651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2417  -22.7805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9444  -23.1822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6492  -22.7737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6427  -21.9553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9353  -21.5531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5296  -20.7339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8177  -20.3253    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.7293  -19.5105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9259  -19.3406    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.5131  -20.0525    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0641  -20.6596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4353  -19.0926    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   13.1509  -19.4988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8946  -21.4632    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   12.5310  -24.0187    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   14.5663  -19.4886    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.2712  -19.0753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9780  -19.4808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6825  -19.0682    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.6775  -18.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9621  -17.8465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2606  -18.2614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9817  -20.2980    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   15.9538  -17.0294    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  9  1  0
  8  4  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13  8  2  0
  4 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 15  1  0
 16 20  1  0
 20 21  1  0
 19 22  1  0
  7 23  1  0
 21  2  1  0
  2 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 26 31  1  0
 29 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4556590

    ---

Associated Targets(Human)

SLC22A12 Tclin Solute carrier family 22 member 12 (799 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 638.19Molecular Weight (Monoisotopic): 634.8254AlogP: 6.20#Rotatable Bonds: 7
Polar Surface Area: 89.77Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 8.94CX Basic pKa: CX LogP: 5.16CX LogD: 5.15
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.19Np Likeness Score: -1.80

References

1. Wu JW, Yin L, Liu YQ, Zhang H, Xie YF, Wang RL, Zhao GL..  (2019)  Synthesis, biological evaluation and 3D-QSAR studies of 1,2,4-triazole-5-substituted carboxylic acid bioisosteres as uric acid transporter 1 (URAT1) inhibitors for the treatment of hyperuricemia associated with gout.,  29  (3): [PMID:30579795] [10.1016/j.bmcl.2018.12.036]

Source