The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-oxo-2-(4-phenylpiperazin-1-yl)ethylthio)-3-phenyl-3H-pyrimido[5,4-b]indol-4(5H)-one ID: ALA4556653
PubChem CID: 4610973
Max Phase: Preclinical
Molecular Formula: C28H25N5O2S
Molecular Weight: 495.61
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CSc1nc2c([nH]c3ccccc32)c(=O)n1-c1ccccc1)N1CCN(c2ccccc2)CC1
Standard InChI: InChI=1S/C28H25N5O2S/c34-24(32-17-15-31(16-18-32)20-9-3-1-4-10-20)19-36-28-30-25-22-13-7-8-14-23(22)29-26(25)27(35)33(28)21-11-5-2-6-12-21/h1-14,29H,15-19H2
Standard InChI Key: WOVORCLTHQFVFU-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 41 0 0 0 0 0 0 0 0999 V2000
3.6234 -2.1957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6222 -3.0230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3370 -3.4358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3352 -1.7830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0505 -2.1920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0508 -3.0231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8408 -1.9351 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3295 -2.6071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8353 -3.2802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1692 -4.0404 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9983 -4.1341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4924 -3.4612 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1576 -2.6945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3123 -3.5523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6399 -4.3079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4589 -4.3994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9488 -3.7345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6137 -2.9760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7956 -2.8882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3289 -4.8899 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.8397 -5.5542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1704 -6.3100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6812 -6.9742 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9902 -6.4014 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8649 -6.8785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3763 -7.5387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7032 -8.2965 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5238 -8.3902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0174 -7.7259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2114 -8.9589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3921 -8.8622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9006 -9.5238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2284 -10.2819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0525 -10.3743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5403 -9.7117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6450 -2.0288 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 9 1 0
8 7 1 0
7 5 1 0
8 9 2 0
8 13 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 1 0
12 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
11 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
23 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
27 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
13 36 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 495.61Molecular Weight (Monoisotopic): 495.1729AlogP: 4.31#Rotatable Bonds: 5Polar Surface Area: 74.23Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.34CX Basic pKa: 3.44CX LogP: 4.59CX LogD: 4.59Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.29Np Likeness Score: -1.56
References 1. (2012) Entpd5 inhibitors,