2-(2-oxo-2-(4-phenylpiperazin-1-yl)ethylthio)-3-phenyl-3H-pyrimido[5,4-b]indol-4(5H)-one

ID: ALA4556653

PubChem CID: 4610973

Max Phase: Preclinical

Molecular Formula: C28H25N5O2S

Molecular Weight: 495.61

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(CSc1nc2c([nH]c3ccccc32)c(=O)n1-c1ccccc1)N1CCN(c2ccccc2)CC1

Standard InChI:  InChI=1S/C28H25N5O2S/c34-24(32-17-15-31(16-18-32)20-9-3-1-4-10-20)19-36-28-30-25-22-13-7-8-14-23(22)29-26(25)27(35)33(28)21-11-5-2-6-12-21/h1-14,29H,15-19H2

Standard InChI Key:  WOVORCLTHQFVFU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 41  0  0  0  0  0  0  0  0999 V2000
    3.6234   -2.1957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6222   -3.0230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3370   -3.4358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3352   -1.7830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0505   -2.1920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0508   -3.0231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8408   -1.9351    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3295   -2.6071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8353   -3.2802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1692   -4.0404    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9983   -4.1341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4924   -3.4612    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1576   -2.6945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3123   -3.5523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6399   -4.3079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4589   -4.3994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9488   -3.7345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6137   -2.9760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7956   -2.8882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3289   -4.8899    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.8397   -5.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1704   -6.3100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6812   -6.9742    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.9902   -6.4014    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8649   -6.8785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3763   -7.5387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7032   -8.2965    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5238   -8.3902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0174   -7.7259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2114   -8.9589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3921   -8.8622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9006   -9.5238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2284  -10.2819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0525  -10.3743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5403   -9.7117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6450   -2.0288    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  9  1  0
  8  7  1  0
  7  5  1  0
  8  9  2  0
  8 13  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 12 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 11 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  2  0
 23 25  1  0
 23 29  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 27 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 13 36  2  0
M  END

Associated Targets(Human)

ENTPD5 Tbio Ectonucleoside triphosphate diphosphohydrolase 5 (478 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

pyrH Uridylate kinase (158 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 495.61Molecular Weight (Monoisotopic): 495.1729AlogP: 4.31#Rotatable Bonds: 5
Polar Surface Area: 74.23Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.34CX Basic pKa: 3.44CX LogP: 4.59CX LogD: 4.59
Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.29Np Likeness Score: -1.56

References

1.  (2012)  Entpd5 inhibitors, 

Source