The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(4-Methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)-1,3-dihydro-2H-imidazo[4,5-c]pyridin-2-one ID: ALA4556665
PubChem CID: 155557161
Max Phase: Preclinical
Molecular Formula: C22H21N3O5
Molecular Weight: 407.43
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2cc3c(cn2)[nH]c(=O)n3-c2cc(OC)c(OC)c(OC)c2)cc1
Standard InChI: InChI=1S/C22H21N3O5/c1-27-15-7-5-13(6-8-15)16-11-18-17(12-23-16)24-22(26)25(18)14-9-19(28-2)21(30-4)20(10-14)29-3/h5-12H,1-4H3,(H,24,26)
Standard InChI Key: XGYGPLIJNGOLKU-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
27.5118 -14.2746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2215 -13.8652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2187 -13.0425 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.5100 -12.6373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8038 -13.8657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8005 -13.0492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0229 -12.7999 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.5456 -13.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0283 -14.1211 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.7284 -13.4658 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.7789 -14.8993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9786 -15.0697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7291 -15.8471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2786 -16.4531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0808 -16.2765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3266 -15.4994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6322 -16.8796 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.3856 -17.6587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0303 -17.2317 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.2319 -17.4059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9304 -16.0199 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.3814 -15.4146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9263 -14.2719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9263 -15.0902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6338 -15.4976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3418 -15.0879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3379 -14.2665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6298 -13.8627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0507 -15.4944 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.0531 -16.3116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
8 10 2 0
9 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
15 17 1 0
17 18 1 0
14 19 1 0
19 20 1 0
13 21 1 0
21 22 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
2 23 1 0
26 29 1 0
29 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 407.43Molecular Weight (Monoisotopic): 407.1481AlogP: 3.42#Rotatable Bonds: 6Polar Surface Area: 87.60Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.90CX Basic pKa: 2.94CX LogP: 3.03CX LogD: 3.03Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.53Np Likeness Score: -0.63
References 1. Gao F, Liang Y, Zhou P, Cheng J, Ding K, Wang Y.. (2019) Design, synthesis, antitumor activities and biological studies of novel diaryl substituted fused heterocycles as dual ligands targeting tubulin and katanin., 178 [PMID:31185410 ] [10.1016/j.ejmech.2019.05.072 ]