1-Benzyl-4-(isopentylamino)-5-methylpyrimidin-2(1H)-one

ID: ALA4556687

PubChem CID: 155557231

Max Phase: Preclinical

Molecular Formula: C17H23N3O

Molecular Weight: 285.39

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cn(Cc2ccccc2)c(=O)nc1NCCC(C)C

Standard InChI:  InChI=1S/C17H23N3O/c1-13(2)9-10-18-16-14(3)11-20(17(21)19-16)12-15-7-5-4-6-8-15/h4-8,11,13H,9-10,12H2,1-3H3,(H,18,19,21)

Standard InChI Key:  CBUKLCROUUHPPZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 21 22  0  0  0  0  0  0  0  0999 V2000
    8.0549   -4.4202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0538   -5.2398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7618   -5.6487    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4715   -5.2393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4687   -4.4166    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.7600   -4.0114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3471   -4.0118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1798   -5.6468    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7616   -6.4659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7576   -3.1942    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4692   -6.8747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4649   -7.6901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1717   -8.0988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8805   -7.6903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8780   -6.8689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1707   -6.4639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4641   -2.7835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1730   -3.1899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8795   -2.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5884   -3.1857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8771   -1.9621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  4  8  2  0
  3  9  1  0
  6 10  1  0
  9 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 10 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 19 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4556687

    ---

Associated Targets(non-human)

Tlr4 Toll-like receptor 4 (76 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 285.39Molecular Weight (Monoisotopic): 285.1841AlogP: 3.06#Rotatable Bonds: 6
Polar Surface Area: 46.92Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 2.99CX LogD: 2.99
Aromatic Rings: 2Heavy Atoms: 21QED Weighted: 0.89Np Likeness Score: -0.88

References

1. Trifonov L, Nudelman V, Zhenin M, Matsree E, Afri M, Schmerling B, Cohen G, Jozwiak K, Weitman M, Korshin E, Senderowitz H, Shainberg A, Hochhauser E, Gruzman A..  (2018)  Structurally Simple, Readily Available Peptidomimetic 1-Benzyl-5-methyl-4-( n-octylamino)pyrimidin-2(1 H)-one Exhibited Efficient Cardioprotection in a Myocardial Ischemia (MI) Mouse Model.,  61  (24): [PMID:30507195] [10.1021/acs.jmedchem.8b01471]

Source