The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(dipyridin-2-ylmethylene)-N-(6-((4-methylpiperidin-1-yl)methyl)benzo[d]thiazol-2-yl)hydrazinecarboxamide ID: ALA4556693
PubChem CID: 141740388
Max Phase: Preclinical
Molecular Formula: C26H27N7OS
Molecular Weight: 485.62
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC1CCN(Cc2ccc3nc(NC(=O)NN=C(c4ccccn4)c4ccccn4)sc3c2)CC1
Standard InChI: InChI=1S/C26H27N7OS/c1-18-10-14-33(15-11-18)17-19-8-9-20-23(16-19)35-26(29-20)30-25(34)32-31-24(21-6-2-4-12-27-21)22-7-3-5-13-28-22/h2-9,12-13,16,18H,10-11,14-15,17H2,1H3,(H2,29,30,32,34)
Standard InChI Key: ACMHTBZGSZSJCZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
28.3155 -19.7983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3144 -20.6178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0224 -21.0268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0206 -19.3894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7292 -19.7947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7340 -20.6133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5141 -20.8617 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.9914 -20.1966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5063 -19.5372 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
31.8086 -20.1918 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.6077 -19.3899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9001 -19.7986 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.2130 -19.4817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0302 -19.4769 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.8003 -18.7764 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.4346 -18.7668 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.2518 -18.7620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6562 -18.0519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4710 -18.0497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8753 -17.3404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4625 -16.6341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6411 -16.6416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2405 -17.3514 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.1921 -19.3893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4866 -19.7946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4825 -20.6121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1902 -21.0227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9019 -20.6158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7734 -21.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6645 -19.4672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2588 -20.1741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6709 -20.8789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4890 -20.8746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8932 -20.1595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4788 -19.4576 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
8 10 1 0
1 11 1 0
11 12 1 0
10 13 1 0
13 14 1 0
13 15 2 0
14 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
12 24 1 0
12 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
26 29 1 0
17 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 485.62Molecular Weight (Monoisotopic): 485.1998AlogP: 4.89#Rotatable Bonds: 6Polar Surface Area: 95.40Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.49CX Basic pKa: 7.39CX LogP: 3.89CX LogD: 3.73Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.30Np Likeness Score: -1.96
References 1. Ma J, Ni X, Gao Y, Huang K, Liu J, Wang Y, Chen R, Wang C.. (2019) Identification and biological evaluation of novel benzothiazole derivatives bearing a pyridine-semicarbazone moiety as apoptosis inducers via activation of procaspase-3 to caspase-3., 10 (3): [PMID:31015910 ] [10.1039/C8MD00624E ]