The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,4R)-4-{[(S)-2-Carboxy-2-(4-phenyl-butyrylamino)-ethylcarbamoyl]-methoxy}-2-(pyridin-2-ylaminomethyl)-pyrrolidine-1-carboxylic acid benzyl ester ID: ALA4556772
PubChem CID: 58916185
Max Phase: Preclinical
Molecular Formula: C33H39N5O7
Molecular Weight: 617.70
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CO[C@@H]1C[C@@H](CNc2ccccn2)N(C(=O)OCc2ccccc2)C1)NC[C@H](NC(=O)CCCc1ccccc1)C(=O)O
Standard InChI: InChI=1S/C33H39N5O7/c39-30(16-9-14-24-10-3-1-4-11-24)37-28(32(41)42)20-36-31(40)23-44-27-18-26(19-35-29-15-7-8-17-34-29)38(21-27)33(43)45-22-25-12-5-2-6-13-25/h1-8,10-13,15,17,26-28H,9,14,16,18-23H2,(H,34,35)(H,36,40)(H,37,39)(H,41,42)/t26-,27+,28-/m0/s1
Standard InChI Key: FFLMJKGHLKUKDV-IARZGTGTSA-N
Molfile:
RDKit 2D
45 48 0 0 0 0 0 0 0 0999 V2000
11.4178 -9.9774 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6480 -10.2908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9928 -9.7770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1116 -8.9542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5866 -8.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7667 -8.4505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2379 -7.8075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4433 -8.0648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1740 -8.8463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3513 -8.8298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1173 -8.0473 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3271 -7.7786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1631 -6.9685 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3809 -6.6976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2188 -5.8864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8445 -5.3491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6871 -4.5386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9043 -4.2670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2788 -4.8163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4436 -5.6248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7053 -8.3215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8007 -7.5767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7855 -9.4302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9917 -9.2410 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4298 -9.8372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6260 -9.6491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0602 -10.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3110 -11.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1020 -11.2302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6719 -10.6256 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8779 -7.5357 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5334 -11.1137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7634 -11.4229 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1870 -11.6194 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5302 -9.1628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2919 -8.8527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8809 -8.6581 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4042 -8.0381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1659 -7.7281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2783 -6.9135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0399 -6.6066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1524 -5.7928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5027 -5.2874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7380 -5.6014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6291 -6.4143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 6
3 2 1 0
4 3 1 0
5 4 1 0
6 5 1 0
7 6 1 0
8 7 1 6
9 8 1 0
10 9 1 0
11 10 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
12 21 2 0
11 22 1 0
8 22 1 0
10 23 1 1
23 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
25 30 2 0
5 31 2 0
2 32 1 0
32 33 2 0
32 34 1 0
1 35 1 0
35 36 1 0
35 37 2 0
36 38 1 0
38 39 1 0
39 40 1 0
40 41 2 0
41 42 1 0
42 43 2 0
43 44 1 0
44 45 2 0
45 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 617.70Molecular Weight (Monoisotopic): 617.2849AlogP: 3.00#Rotatable Bonds: 16Polar Surface Area: 159.19Molecular Species: ACIDHBA: 8HBD: 4#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.74CX Basic pKa: 6.63CX LogP: 1.02CX LogD: 0.21Aromatic Rings: 3Heavy Atoms: 45QED Weighted: 0.19Np Likeness Score: -0.56
References 1. (2013) Compounds for the inhibition of angiogenesis and use thereof,