The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
allyl 4-(4-((5-chloro-4-((2-(methylcarbamoyl)phenyl)amino)pyrimidin-2-yl)amino)benzoyl)piperazine-1-carbodithioate ID: ALA4556839
PubChem CID: 155556743
Max Phase: Preclinical
Molecular Formula: C27H28ClN7O2S2
Molecular Weight: 582.16
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CCSC(=S)N1CCN(C(=O)c2ccc(Nc3ncc(Cl)c(Nc4ccccc4C(=O)NC)n3)cc2)CC1
Standard InChI: InChI=1S/C27H28ClN7O2S2/c1-3-16-39-27(38)35-14-12-34(13-15-35)25(37)18-8-10-19(11-9-18)31-26-30-17-21(28)23(33-26)32-22-7-5-4-6-20(22)24(36)29-2/h3-11,17H,1,12-16H2,2H3,(H,29,36)(H2,30,31,32,33)
Standard InChI Key: DBRYPYAIGZIDIU-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
19.7763 -3.7434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7751 -4.5629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4832 -4.9719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1928 -4.5624 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.1900 -3.7398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4814 -3.3345 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.8962 -3.3285 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.6054 -3.7344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0685 -3.3349 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.3608 -3.7437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6532 -3.3335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9460 -3.7416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9458 -4.5597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6586 -4.9679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3628 -4.5575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6051 -4.5493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3136 -4.9551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0207 -4.5438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0150 -3.7224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3060 -3.3203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7305 -4.9488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7346 -5.7660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.4361 -4.5366 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.1428 -4.9472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8463 -4.5385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8463 -3.7210 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.1367 -3.3138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4270 -3.7242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6539 -2.5163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3620 -2.1084 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.9466 -2.1071 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9473 -1.2899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0671 -4.9709 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
27.5535 -3.3115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2617 -3.7191 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
27.5524 -2.4943 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
28.9689 -3.3096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6772 -3.7173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3843 -3.3077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
1 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
8 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 8 1 0
18 21 1 0
21 22 2 0
21 23 1 0
23 24 1 0
23 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
11 29 1 0
29 30 2 0
29 31 1 0
31 32 1 0
2 33 1 0
26 34 1 0
34 35 1 0
34 36 2 0
35 37 1 0
37 38 1 0
38 39 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 582.16Molecular Weight (Monoisotopic): 581.1434AlogP: 4.94#Rotatable Bonds: 8Polar Surface Area: 102.49Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.47CX Basic pKa: 2.48CX LogP: 6.44CX LogD: 6.44Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.25Np Likeness Score: -1.59
References 1. Su Y, Li R, Ning X, Lin Z, Zhao X, Zhou J, Liu J, Jin Y, Yin Y.. (2019) Discovery of 2,4-diarylaminopyrimidine derivatives bearing dithiocarbamate moiety as novel FAK inhibitors with antitumor and anti-angiogenesis activities., 177 [PMID:31129452 ] [10.1016/j.ejmech.2019.05.048 ]