The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-(1-hexyl-5-hydroxy-4-oxo-1,4-dihydropyridin-2-yl)methyl 2-amino-3-phenylpropanoate ID: ALA4556868
PubChem CID: 72163243
Max Phase: Preclinical
Molecular Formula: C21H28N2O4
Molecular Weight: 372.47
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCn1cc(O)c(=O)cc1COC(=O)[C@@H](N)Cc1ccccc1
Standard InChI: InChI=1S/C21H28N2O4/c1-2-3-4-8-11-23-14-20(25)19(24)13-17(23)15-27-21(26)18(22)12-16-9-6-5-7-10-16/h5-7,9-10,13-14,18,25H,2-4,8,11-12,15,22H2,1H3/t18-/m0/s1
Standard InChI Key: YYFGOTXRWISRGI-SFHVURJKSA-N
Molfile:
RDKit 2D
27 28 0 0 0 0 0 0 0 0999 V2000
20.8287 -19.9138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8276 -20.7334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5356 -21.1423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2453 -20.7329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2424 -19.9102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5338 -19.5050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9536 -21.1404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9549 -21.9576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6632 -22.3651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2478 -22.3673 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.6645 -23.1823 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.3703 -21.9554 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.0787 -22.3628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7857 -21.9531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4919 -22.3654 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.1969 -21.9591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1998 -21.1416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4916 -20.7319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7805 -21.1398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9084 -20.7346 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.4931 -19.9147 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.4896 -23.1825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1962 -23.5931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9051 -23.1865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6116 -23.5971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3205 -23.1904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0270 -23.6010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
8 9 1 0
8 10 1 1
9 11 2 0
9 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
14 19 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 1 0
17 20 1 0
18 21 2 0
15 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 372.47Molecular Weight (Monoisotopic): 372.2049AlogP: 2.75#Rotatable Bonds: 10Polar Surface Area: 94.55Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.76CX Basic pKa: 6.77CX LogP: 3.52CX LogD: 3.43Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.49Np Likeness Score: 0.07