The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-((3-(2-fluoro-4'-(pyrrolidine-1-carbonyl)-[1,1'-biphenyl]-4-yl)-2-oxooxazolidin-5-yl)methyl)acetamide ID: ALA4556879
PubChem CID: 155556971
Max Phase: Preclinical
Molecular Formula: C23H24FN3O4
Molecular Weight: 425.46
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)NC[C@H]1CN(c2ccc(-c3ccc(C(=O)N4CCCC4)cc3)c(F)c2)C(=O)O1
Standard InChI: InChI=1S/C23H24FN3O4/c1-15(28)25-13-19-14-27(23(30)31-19)18-8-9-20(21(24)12-18)16-4-6-17(7-5-16)22(29)26-10-2-3-11-26/h4-9,12,19H,2-3,10-11,13-14H2,1H3,(H,25,28)/t19-/m0/s1
Standard InChI Key: OIZVSRTWYJVXLX-IBGZPJMESA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
5.6047 -11.8672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4201 -11.8684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8270 -11.1639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4197 -10.4578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6011 -10.4606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1979 -11.1656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6404 -11.1616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0483 -11.8710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8647 -11.8715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2743 -11.1634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8615 -10.4532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0464 -10.4562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0897 -11.1632 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5708 -11.8238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3477 -11.5704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3468 -10.7532 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5693 -10.5016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3159 -9.7247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0093 -12.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7555 -11.7168 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4172 -12.1964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1633 -11.8633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3326 -13.0093 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6360 -9.7495 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.3807 -11.1681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9700 -10.4616 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9775 -11.8773 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1659 -11.9717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0016 -12.7708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7109 -13.1741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3134 -12.6241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
3 7 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 13 1 0
10 13 1 0
17 18 2 0
15 19 1 1
19 20 1 0
20 21 1 0
21 22 1 0
21 23 2 0
12 24 1 0
6 25 1 0
25 26 2 0
25 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 27 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 425.46Molecular Weight (Monoisotopic): 425.1751AlogP: 3.19#Rotatable Bonds: 5Polar Surface Area: 78.95Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 2.10CX LogD: 2.10Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.80Np Likeness Score: -1.36
References 1. Xu S, Jiang J, Qi Y, Ding X, Wu Y, Lei H, Zhao Y.. (2019) Design and synthesis of biaryloxazolidinone derivatives containing amide or acrylamide moiety as novel antibacterial agents against Gram-positive bacteria., 29 (23): [PMID:31668973 ] [10.1016/j.bmcl.2019.126747 ]