The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-Cyclopentyl-2-((4-(N-(5-isothiocyanatopentyl)sulfamoyl)phenyl)amino)-N,N-dimethyl-7H-pyrrolo[2,3-d]pyrimidine-6-carboxamide ID: ALA4556974
PubChem CID: 155556844
Max Phase: Preclinical
Molecular Formula: C26H33N7O3S2
Molecular Weight: 555.73
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)C(=O)c1cc2cnc(Nc3ccc(S(=O)(=O)NCCCCCN=C=S)cc3)nc2n1C1CCCC1
Standard InChI: InChI=1S/C26H33N7O3S2/c1-32(2)25(34)23-16-19-17-28-26(31-24(19)33(23)21-8-4-5-9-21)30-20-10-12-22(13-11-20)38(35,36)29-15-7-3-6-14-27-18-37/h10-13,16-17,21,29H,3-9,14-15H2,1-2H3,(H,28,30,31)
Standard InChI Key: NWGIMFWNMSCXFM-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
22.9061 -16.9299 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.1178 -16.7194 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
22.3297 -17.5073 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.8304 -12.2248 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.8293 -13.0443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5373 -13.4533 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.5355 -11.8160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2441 -12.2212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2444 -13.0398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0231 -13.2926 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.5041 -12.6301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0226 -11.9681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3213 -12.6298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7296 -11.9220 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.5468 -11.9217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3208 -11.2144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7301 -13.3374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.2799 -14.0717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7998 -14.7330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2803 -15.3940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0575 -15.1412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0571 -14.3241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1212 -13.4524 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.1206 -14.2696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4124 -14.6761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4115 -15.4925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1194 -15.9025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8298 -15.4900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8273 -14.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4123 -17.1286 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.7038 -16.7215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9969 -17.1315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2884 -16.7244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5815 -17.1344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8730 -16.7272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1661 -17.1373 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.4575 -16.7301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7454 -16.3191 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 8 1 0
11 13 1 0
13 14 1 0
14 15 1 0
14 16 1 0
13 17 2 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 18 1 0
10 18 1 0
5 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
27 2 1 0
2 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 2 0
37 38 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 555.73Molecular Weight (Monoisotopic): 555.2086AlogP: 4.54#Rotatable Bonds: 12Polar Surface Area: 121.58Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.63CX Basic pKa: 3.69CX LogP: 4.18CX LogD: 4.18Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.19Np Likeness Score: -1.21
References 1. Wang X, Yu C, Wang C, Ma Y, Wang T, Li Y, Huang Z, Zhou M, Sun P, Zheng J, Yang S, Fan Y, Xiang R.. (2019) Novel cyclin-dependent kinase 9 (CDK9) inhibitor with suppression of cancer stemness activity against non-small-cell lung cancer., 181 [PMID:31376566 ] [10.1016/j.ejmech.2019.07.038 ]