2-tert-butoxy-2-(3-(chroman-6-yl)-1-(4-methoxyphenyl)isoquinolin-4-yl)acetic acid

ID: ALA4557062

PubChem CID: 145999228

Max Phase: Preclinical

Molecular Formula: C31H31NO5

Molecular Weight: 497.59

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2nc(-c3ccc4c(c3)CCCO4)c(C(OC(C)(C)C)C(=O)O)c3ccccc23)cc1

Standard InChI:  InChI=1S/C31H31NO5/c1-31(2,3)37-29(30(33)34)26-23-9-5-6-10-24(23)27(19-11-14-22(35-4)15-12-19)32-28(26)21-13-16-25-20(18-21)8-7-17-36-25/h5-6,9-16,18,29H,7-8,17H2,1-4H3,(H,33,34)

Standard InChI Key:  MRLPDFXJJBCOPD-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   24.4070  -11.7997    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.4059  -12.6192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8207  -11.7961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1121  -11.3908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8236  -12.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1131  -13.0260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1116  -13.8431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8198  -14.2539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5310  -13.8416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5290  -13.0259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5269  -11.3849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2362  -11.7908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5238  -10.5677    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.2300  -10.1564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2269   -9.3392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9392  -10.5623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9331   -9.7403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2392  -12.6080    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.9423  -11.3795    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.7008  -13.0282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9928  -12.6180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2856  -13.0260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2853  -13.8440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9980  -14.2524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7023  -13.8420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1069  -10.5765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8150  -10.1664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8129   -9.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4002  -10.1728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3946   -9.3578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0991   -8.9420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0914   -8.1285    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.3807   -7.7246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6762   -8.1404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6824   -8.9600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5781  -14.2536    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.8698  -13.8461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  6  1  0
  5  3  1  0
  3  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10  5  2  0
  3 11  1  0
 11 12  1  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  1  0
 14 17  1  0
 12 18  2  0
 12 19  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
  2 20  1  0
 26 27  2  0
 27 28  1  0
 28 31  2  0
 30 29  2  0
 29 26  1  0
  4 26  1  0
 30 31  1  0
 30 35  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 23 36  1  0
 36 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4557062

    ---

Associated Targets(non-human)

pol Human immunodeficiency virus type 1 integrase (9041 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 497.59Molecular Weight (Monoisotopic): 497.2202AlogP: 6.84#Rotatable Bonds: 6
Polar Surface Area: 77.88Molecular Species: ACIDHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.60CX Basic pKa: 4.27CX LogP: 5.97CX LogD: 3.40
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.31Np Likeness Score: -0.33

References

1. Wilson TA, Koneru PC, Rebensburg SV, Lindenberger JJ, Kobe MJ, Cockroft NT, Adu-Ampratwum D, Larue RC, Kvaratskhelia M, Fuchs JR..  (2019)  An Isoquinoline Scaffold as a Novel Class of Allosteric HIV-1 Integrase Inhibitors.,  10  (2): [PMID:30783506] [10.1021/acsmedchemlett.8b00633]

Source