2-Deoxy-2-acetamido-beta-D-glucopyranosyl-16-oxo-ent-beyeran-19-oate

ID: ALA4557063

PubChem CID: 155556753

Max Phase: Preclinical

Molecular Formula: C28H43NO8

Molecular Weight: 521.65

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)N[C@H]1[C@H](OC(=O)[C@]2(C)CCC[C@@]3(C)[C@@H]4CC[C@@]5(C)C[C@]4(CC[C@@H]32)CC5=O)O[C@H](CO)[C@@H](O)[C@@H]1O

Standard InChI:  InChI=1S/C28H43NO8/c1-15(31)29-20-22(34)21(33)16(13-30)36-23(20)37-24(35)27(4)9-5-8-26(3)17(27)7-11-28-12-19(32)25(2,14-28)10-6-18(26)28/h16-18,20-23,30,33-34H,5-14H2,1-4H3,(H,29,31)/t16-,17+,18+,20-,21-,22-,23+,25+,26-,27-,28+/m1/s1

Standard InChI Key:  QLSSQYAEZVYJHC-IWLIWMDTSA-N

Molfile:  

 
     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
    5.4348  -29.4837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2520  -29.4859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6584  -28.7818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2559  -28.0754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0282  -28.7749    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4387  -28.0683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6597  -30.1942    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4756  -28.7840    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0243  -30.1903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0342  -27.3582    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2180  -27.3553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8136  -26.6536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4087  -27.3527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1161  -25.4361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1161  -26.2492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8172  -25.0275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5184  -25.4361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5149  -26.2492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2128  -26.6585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9187  -26.2552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2198  -25.0324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9222  -25.4469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6341  -25.0507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6457  -24.2342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9391  -23.8155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2251  -24.2175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2185  -24.8046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7026  -25.6549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5111  -24.6230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7585  -23.4295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0255  -24.7051    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5069  -27.0622    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2127  -25.8488    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8090  -28.0627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2071  -30.1880    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6696  -27.3706    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4867  -27.3765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9004  -26.6717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8902  -28.0871    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  6  1  0
  1  5  1  0
  5  6  1  0
  2  7  1  6
  3  8  1  1
  1  9  1  1
  6 10  1  1
 12 11  1  6
 13 12  1  0
 14 15  1  0
 14 16  1  0
 15 12  1  0
 12 18  1  0
 17 16  1  0
 17 18  1  0
 17 21  1  0
 18 19  1  0
 19 20  1  0
 20 22  1  0
 21 22  1  0
 21 26  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 24 27  1  0
 22 28  1  6
 28 27  1  0
 17 29  1  6
 24 30  1  1
 27 31  2  0
 18 32  1  1
 21 33  1  1
 11 34  2  0
 11 10  1  0
  9 35  1  0
  4 36  1  6
 36 37  1  0
 37 38  1  0
 37 39  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4557063

    ---

Associated Targets(Human)

M-HeLa (156 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 521.65Molecular Weight (Monoisotopic): 521.2989AlogP: 1.85#Rotatable Bonds: 4
Polar Surface Area: 142.39Molecular Species: NEUTRALHBA: 8HBD: 4
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.35CX Basic pKa: CX LogP: 1.95CX LogD: 1.95
Aromatic Rings: Heavy Atoms: 37QED Weighted: 0.41Np Likeness Score: 2.46

References

1. Sharipova RR, Belenok MG, Garifullin BF, Sapunova AS, Voloshina AD, Andreeva OV, Strobykina IY, Skvortsova PV, Zuev YF, Kataev VE..  (2019)  Synthesis and anti-cancer activities of glycosides and glycoconjugates of diterpenoid isosteviol.,  10  (8): [PMID:31673312] [10.1039/C9MD00242A]

Source