The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(5-(3-(1-Naphthoyl)-1H-indol-1-yl)pentyl)acetamide ID: ALA4557161
PubChem CID: 155554815
Max Phase: Preclinical
Molecular Formula: C26H26N2O2
Molecular Weight: 398.51
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)NCCCCCn1cc(C(=O)c2cccc3ccccc23)c2ccccc21
Standard InChI: InChI=1S/C26H26N2O2/c1-19(29)27-16-7-2-8-17-28-18-24(22-13-5-6-15-25(22)28)26(30)23-14-9-11-20-10-3-4-12-21(20)23/h3-6,9-15,18H,2,7-8,16-17H2,1H3,(H,27,29)
Standard InChI Key: QUMOGKIRMOIRTP-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
15.2500 -10.7623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2329 -11.5858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9369 -12.0126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9671 -10.3673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6718 -10.7863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6606 -11.6090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4398 -11.8726 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.9300 -11.2169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4579 -10.5440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7210 -9.7662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5267 -9.6073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1784 -9.1474 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.1347 -9.2852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5874 -8.6649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7843 -8.8307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8709 -10.0636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0683 -10.2211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8029 -10.9940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3431 -11.6101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1480 -11.4482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4056 -10.6754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6816 -12.6573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1224 -13.2612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3643 -14.0459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8092 -14.6497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0511 -15.4345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4919 -16.0342 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.7378 -16.8189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1786 -17.4228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5389 -17.0039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
9 10 1 0
10 11 1 0
10 12 2 0
11 17 2 0
16 13 2 0
13 14 1 0
14 15 2 0
15 11 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
7 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
28 30 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 398.51Molecular Weight (Monoisotopic): 398.1994AlogP: 5.33#Rotatable Bonds: 8Polar Surface Area: 51.10Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.79CX LogD: 4.79Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.32Np Likeness Score: -0.96
References 1. Dvorácskó S, Keresztes A, Mollica A, Stefanucci A, Macedonio G, Pieretti S, Zádor F, Walter FR, Deli MA, Kékesi G, Bánki L, Tuboly G, Horváth G, Tömböly C.. (2019) Preparation of bivalent agonists for targeting the mu opioid and cannabinoid receptors., 178 [PMID:31220675 ] [10.1016/j.ejmech.2019.05.037 ]