The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-(3,4-dimethoxybenzyl)-1-(2-((1-methyl-1H-pyrazol-4-yl)amino)pyridin-4-yl)piperidine-3-carboxamide ID: ALA4557265
PubChem CID: 141488418
Max Phase: Preclinical
Molecular Formula: C24H30N6O3
Molecular Weight: 450.54
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CNC(=O)[C@H]2CCCN(c3ccnc(Nc4cnn(C)c4)c3)C2)cc1OC
Standard InChI: InChI=1S/C24H30N6O3/c1-29-16-19(14-27-29)28-23-12-20(8-9-25-23)30-10-4-5-18(15-30)24(31)26-13-17-6-7-21(32-2)22(11-17)33-3/h6-9,11-12,14,16,18H,4-5,10,13,15H2,1-3H3,(H,25,28)(H,26,31)/t18-/m0/s1
Standard InChI Key: FHDHVZJNGQPHFZ-SFHVURJKSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
5.9927 -20.3637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9927 -21.1851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7021 -21.5937 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4115 -21.1851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4115 -20.3637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7021 -19.9510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7017 -22.4141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9882 -22.8221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9879 -23.6427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7003 -24.0562 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4144 -23.6391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4113 -22.8199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1246 -19.9572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8352 -20.3679 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1270 -19.1359 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5482 -19.9614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2589 -20.3720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2551 -21.1944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9608 -21.6091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6748 -21.1984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6746 -20.3728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9642 -19.9660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2759 -24.0551 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5676 -23.6474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4786 -22.8383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6791 -22.6695 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2714 -23.3778 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8191 -23.9843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3457 -21.9234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3815 -19.9629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0900 -20.3702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3823 -21.6075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3817 -22.4247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
3 7 1 0
5 13 1 6
13 14 1 0
13 15 2 0
14 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
9 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 1 0
27 28 2 0
28 24 1 0
26 29 1 0
21 30 1 0
30 31 1 0
20 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 450.54Molecular Weight (Monoisotopic): 450.2379AlogP: 3.11#Rotatable Bonds: 8Polar Surface Area: 93.54Molecular Species: BASEHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.62CX LogP: 2.38CX LogD: 1.32Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.54Np Likeness Score: -1.73
References 1. Liu S, Jiang Y, Yan R, Li Z, Wan S, Zhang T, Wu X, Hou J, Zhu Z, Tian Y, Zhang J.. (2019) Design, synthesis and biological evaluations of 2-amino-4-(1-piperidine) pyridine derivatives as novel anti crizotinib-resistant ALK/ROS1 dual inhibitors., 179 [PMID:31260890 ] [10.1016/j.ejmech.2019.06.043 ]