(1S,3S)-3-(6-(4-(((3-fluorobenzyloxy)carbonylamino)methyl)-3-methylisoxazol-5-yl)pyridin-3-yloxy)cyclohexanecarboxylic acid

ID: ALA4557434

PubChem CID: 155153676

Max Phase: Preclinical

Molecular Formula: C25H26FN3O6

Molecular Weight: 483.50

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1noc(-c2ccc(O[C@H]3CCC[C@H](C(=O)O)C3)cn2)c1CNC(=O)OCc1cccc(F)c1

Standard InChI:  InChI=1S/C25H26FN3O6/c1-15-21(13-28-25(32)33-14-16-4-2-6-18(26)10-16)23(35-29-15)22-9-8-20(12-27-22)34-19-7-3-5-17(11-19)24(30)31/h2,4,6,8-10,12,17,19H,3,5,7,11,13-14H2,1H3,(H,28,32)(H,30,31)/t17-,19-/m0/s1

Standard InChI Key:  NEIDHRRNILCHGY-HKUYNNGSSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   19.8182   -5.2805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1109   -4.8672    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.3987   -5.2794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6872   -4.8661    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.3981   -6.1007    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9750   -5.2782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2635   -4.8650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1802   -4.0504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3768   -3.8799    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9635   -4.5914    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.5140   -5.2032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3449   -6.0068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7918   -3.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5734   -3.7598    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.1812   -3.2105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0128   -2.4059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2270   -2.1534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6184   -2.7043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6243   -1.8592    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.4055   -2.1118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5693   -2.9144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3465   -3.1678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9611   -2.6240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7931   -1.8192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0105   -1.5582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8176   -6.1018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1095   -6.5083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1085   -7.3288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8164   -7.7429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5309   -7.3264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5284   -6.5072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5126   -3.9680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9026   -4.5118    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.2885   -4.2243    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.2401   -7.7324    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  3  5  2  0
  4  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11  7  1  0
 11 12  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
  8 13  1  0
 16 19  1  0
 20 19  1  1
 20 21  1  0
 20 25  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
  1 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 22 32  1  6
 32 33  2  0
 32 34  1  0
 30 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4557434

    ---

Associated Targets(Human)

LPAR1 Tchem Lysophosphatidic acid receptor Edg-2 (779 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 483.50Molecular Weight (Monoisotopic): 483.1806AlogP: 4.63#Rotatable Bonds: 8
Polar Surface Area: 123.78Molecular Species: ACIDHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 4.08CX Basic pKa: 1.14CX LogP: 3.50CX LogD: 0.39
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.48Np Likeness Score: -0.93

References

1. Abdel-Magid AF..  (2019)  Lysophosphatidic Acid Receptor 1 Antagonists for the Treatment of Fibrosis.,  10  (10): [PMID:31620221] [10.1021/acsmedchemlett.9b00429]

Source