4-(4-Methoxyphenyl)-5-methyl-3-(4-nitrophenyl)isoxazole

ID: ALA4557726

PubChem CID: 155554611

Max Phase: Preclinical

Molecular Formula: C17H14N2O4

Molecular Weight: 310.31

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2c(-c3ccc([N+](=O)[O-])cc3)noc2C)cc1

Standard InChI:  InChI=1S/C17H14N2O4/c1-11-16(12-5-9-15(22-2)10-6-12)17(18-23-11)13-3-7-14(8-4-13)19(20)21/h3-10H,1-2H3

Standard InChI Key:  FJDFHWJSDVFRJU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
    5.3315  -11.1141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3304  -11.9337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0384  -12.3426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7481  -11.9332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7453  -11.1105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0367  -10.7053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4417  -13.8537    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1047  -13.3758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8503  -12.5950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0331  -12.5950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7788  -13.3758    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5530  -11.9337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1365  -11.1146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1353  -11.9341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8434  -12.3431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5502  -11.1110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8416  -10.7057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8070  -13.7808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4319  -10.7041    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7243  -11.1129    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4317   -9.8869    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4514  -10.6993    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1607  -11.1052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
 10 11  2  0
  8  9  2  0
  7  8  1  0
  9 10  1  0
 11  7  1  0
 10 12  1  0
 13 14  2  0
 14 15  1  0
 15 12  2  0
 12 16  1  0
 16 17  2  0
 17 13  1  0
  9  2  1  0
  8 18  1  0
 19 20  2  0
 19 21  1  0
 13 19  1  0
  5 22  1  0
 22 23  1  0
M  CHG  2  19   1  21  -1
M  END

Alternative Forms

  1. Parent:

    ALA4557726

    ---

Associated Targets(Human)

PTGS2 Tclin Cyclooxygenase-2 (13999 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

PTGS1 Cyclooxygenase-1 (5266 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 310.31Molecular Weight (Monoisotopic): 310.0954AlogP: 4.23#Rotatable Bonds: 4
Polar Surface Area: 78.40Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 0.21CX LogP: 4.00CX LogD: 4.00
Aromatic Rings: 3Heavy Atoms: 23QED Weighted: 0.53Np Likeness Score: -1.17

References

1. Pati ML, Vitale P, Ferorelli S, Iaselli M, Miciaccia M, Boccarelli A, Di Mauro GD, Fortuna CG, Souza Domingos TF, Rodrigues Pereira da Silva LC, de Pádula M, Cabral LM, Sathler PC, Vacca A, Scilimati A, Perrone MG..  (2019)  Translational impact of novel widely pharmacological characterized mofezolac-derived COX-1 inhibitors combined with bortezomib on human multiple myeloma cell lines viability.,  164  [PMID:30590258] [10.1016/j.ejmech.2018.12.029]

Source