The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl 2-[((adamantan-1-yl)carbonyl)amino]-5-phenylthiophene-3-carboxylate ID: ALA4557732
PubChem CID: 155554628
Max Phase: Preclinical
Molecular Formula: C23H25NO3S
Molecular Weight: 395.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1cc(-c2ccccc2)sc1NC(=O)C12CC3CC(CC(C3)C1)C2
Standard InChI: InChI=1S/C23H25NO3S/c1-27-21(25)18-10-19(17-5-3-2-4-6-17)28-20(18)24-22(26)23-11-14-7-15(12-23)9-16(8-14)13-23/h2-6,10,14-16H,7-9,11-13H2,1H3,(H,24,26)
Standard InChI Key: HXLZHXBLBJSXOH-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 32 0 0 0 0 0 0 0 0999 V2000
34.5054 -2.1206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8989 -2.8275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7143 -2.3763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1800 -2.5968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9529 -2.1076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4433 -2.8111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7518 -3.2199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2282 -3.9020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9360 -3.6186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4712 -3.6260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2414 -4.0241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0627 -4.0241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3171 -3.2432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6500 -2.7611 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
28.9912 -3.2432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0244 -2.8272 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.5423 -4.6899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2090 -5.4402 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.3628 -4.6885 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.7406 -3.2281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7493 -4.0494 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.6899 -6.1009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2141 -2.9905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0478 -2.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2715 -1.9388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6631 -2.4857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8362 -3.2887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6123 -3.5378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
2 4 1 0
3 5 1 0
4 6 1 0
5 6 1 0
7 8 1 0
3 7 1 0
2 9 1 0
6 10 1 0
10 8 1 0
8 9 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
15 11 2 0
13 16 1 0
12 17 1 0
17 18 1 0
17 19 2 0
16 20 1 0
20 21 2 0
20 6 1 0
18 22 1 0
15 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 395.52Molecular Weight (Monoisotopic): 395.1555AlogP: 5.36#Rotatable Bonds: 4Polar Surface Area: 55.40Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.50CX Basic pKa: ┄CX LogP: 6.06CX LogD: 6.06Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.71Np Likeness Score: -0.94
References 1. Mugnaini C, Rabbito A, Brizzi A, Palombi N, Petrosino S, Verde R, Di Marzo V, Ligresti A, Corelli F.. (2019) Synthesis of novel 2-(1-adamantanylcarboxamido)thiophene derivatives. Selective cannabinoid type 2 (CB2) receptor agonists as potential agents for the treatment of skin inflammatory disease., 161 [PMID:30359820 ] [10.1016/j.ejmech.2018.09.070 ]