5-chloro-N-(3-(3,4-dimethoxyphenyl)propyl)-2-(1H-1,2,4-triazol-1-yl)aniline

ID: ALA4557757

PubChem CID: 155554832

Max Phase: Preclinical

Molecular Formula: C19H21ClN4O2

Molecular Weight: 372.86

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(CCCNc2cc(Cl)ccc2-n2cncn2)cc1OC

Standard InChI:  InChI=1S/C19H21ClN4O2/c1-25-18-8-5-14(10-19(18)26-2)4-3-9-22-16-11-15(20)6-7-17(16)24-13-21-12-23-24/h5-8,10-13,22H,3-4,9H2,1-2H3

Standard InChI Key:  JWPZKNKCBMPDDI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
    3.0610  -28.6512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0598  -29.4707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7679  -29.8797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4775  -29.4702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4747  -28.6476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7661  -28.2423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7727  -30.6968    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1115  -31.1770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3638  -31.9543    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1811  -31.9545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4336  -31.1774    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1859  -29.8777    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8930  -29.4680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6013  -29.8755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3084  -29.4658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0167  -29.8733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0136  -30.6911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7211  -31.0986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4292  -30.6888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4253  -29.8674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7172  -29.4637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1309  -29.4552    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8407  -29.8602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1381  -31.0953    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1404  -31.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7637  -27.4251    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  7  1  0
  3  7  1  0
  4 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 20 22  1  0
 22 23  1  0
 19 24  1  0
 24 25  1  0
  6 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4557757

    ---

Associated Targets(non-human)

Grm7 Metabotropic glutamate receptor 7 (580 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 372.86Molecular Weight (Monoisotopic): 372.1353AlogP: 3.98#Rotatable Bonds: 8
Polar Surface Area: 61.20Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.29CX LogP: 3.59CX LogD: 3.59
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.61Np Likeness Score: -1.58

References

1. Reed CW, Yohn SE, Washecheck JP, Roenfanz HF, Quitalig MC, Luscombe VB, Jenkins MT, Rodriguez AL, Engers DW, Blobaum AL, Conn PJ, Niswender CM, Lindsley CW..  (2019)  Discovery of an Orally Bioavailable and Central Nervous System (CNS) Penetrant mGlu7 Negative Allosteric Modulator (NAM) in Vivo Tool Compound: N-(2-(1 H-1,2,4-triazol-1-yl)-5-(trifluoromethoxy)phenyl)-4-(cyclopropylmethoxy)-3-methoxybenzamide (VU6012962).,  62  (3): [PMID:30608678] [10.1021/acs.jmedchem.8b01810]

Source