6-Amino-5-(1-(4-chlorophenyl)ethoxy)-1'-methyl[3,4'-bipyridin]-2'(1'H)-one

ID: ALA4557900

PubChem CID: 155554593

Max Phase: Preclinical

Molecular Formula: C19H18ClN3O2

Molecular Weight: 355.83

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(Oc1cc(-c2ccn(C)c(=O)c2)cnc1N)c1ccc(Cl)cc1

Standard InChI:  InChI=1S/C19H18ClN3O2/c1-12(13-3-5-16(20)6-4-13)25-17-9-15(11-22-19(17)21)14-7-8-23(2)18(24)10-14/h3-12H,1-2H3,(H2,21,22)

Standard InChI Key:  PTSWTAUGLDMBJZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
   16.4274  -11.7622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4263  -12.5896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1411  -13.0024    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.8575  -12.5891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8547  -11.7586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1393  -11.3495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7137  -11.3455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7154  -10.5196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0050  -10.1074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2882  -10.5165    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.2864  -11.3425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0014  -11.7592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5727  -13.0005    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.0079   -9.2824    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.5675  -11.3435    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.5645  -10.5185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2773  -10.1033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8484  -10.1087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9886  -10.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7010  -10.1021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6984   -9.2762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9773   -8.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2678   -9.2835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5752  -10.1014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4107   -8.8601    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  7 12  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
  1  7  1  0
  4 13  1  0
  9 14  2  0
  5 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  1  0
 17 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 17  1  0
 10 24  1  0
 21 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4557900

    ---

Associated Targets(Human)

KARPAS-299 (888 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 355.83Molecular Weight (Monoisotopic): 355.1088AlogP: 3.82#Rotatable Bonds: 4
Polar Surface Area: 70.14Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.97CX LogP: 2.89CX LogD: 2.88
Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.77Np Likeness Score: -0.82

References

1. Chen W, Guo X, Zhang C, Ke D, Zhang G, Yu Y..  (2019)  Discovery of 2-aminopyridines bearing a pyridone moiety as potent ALK inhibitors to overcome the crizotinib-resistant mutants.,  183  [PMID:31569004] [10.1016/j.ejmech.2019.111734]

Source